CAS 477-85-0
:Obtusifolin
Description:
Obtusifolin, with the CAS number 477-85-0, is a naturally occurring alkaloid primarily derived from various plant species, particularly those in the Apocynaceae family. This compound is characterized by its complex molecular structure, which includes multiple rings and functional groups that contribute to its biological activity. Obtusifolin exhibits a range of pharmacological properties, including anti-inflammatory, analgesic, and potential anticancer effects, making it a subject of interest in medicinal chemistry. Its solubility profile typically indicates moderate solubility in organic solvents, while its stability can be influenced by environmental factors such as light and temperature. The compound's interactions with biological systems are often mediated through its ability to bind to specific receptors or enzymes, highlighting its potential therapeutic applications. As research continues, the exploration of obtusifolin's mechanisms of action and its efficacy in various biological contexts remains a key area of study in natural product chemistry and pharmacology.
Formula:C16H12O5
InChI:InChI=1S/C16H12O5/c1-7-6-9-12(16(21-2)13(7)18)15(20)11-8(14(9)19)4-3-5-10(11)17/h3-6,17-18H,1-2H3
InChI key:InChIKey=NYRXUBDGDSRBGB-UHFFFAOYSA-N
SMILES:O(C)C1=C2C(C(=O)C=3C(C2=O)=C(O)C=CC3)=CC(C)=C1O
Synonyms:- 2,8-Dihydroxy-1-methoxy-3-methyl-9,10-anthracenedione
- 2,8-Dihydroxy-1-methoxy-3-methyl-9,10-anthraquinone
- 9,10-Anthracenedione, 2,8-dihydroxy-1-methoxy-3-methyl-
- Anthraquinone, 2,8-dihydroxy-1-methoxy-3-methyl-
- Obtusifolin
- Obtusifolin (anthraquinone)
- Obtusifoline
- 2,8-Dihydroxy-1-Methoxy-3-Methylanthraquinone
- 2,8-dihydroxy-1-methoxy-3-methylanthracene-9,10-dione
- Obtusifolin ISO 9001：2015 REACH
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Obtusifolin (Standard)
CAS:Obtusifolin (Standard) is a reference standard for research and analysis in studies involving Obtusifolin. 1. Obtusifolin has antioxidant properties and improves chemically induced diabetes and its complications by modulation of oxidative stress. 2. Obtusifolin suppresses phthalate esters-mediated bone resorption, thus may be a novel anti-breast-cancer bone metastasis agent. 3. Obtusifolin has beneficial effects on the development of diabetic retinopathy via inhibition of accumulation of oxidatively modified DNA and nitrotyrosine in the retina, can help prevent vision loss in diabetic patients. 4. Obtusifolin and gluco-Obtusifolin produce significant antinociceptive action in rodent behavioral models of inflammatory/neuropathic pain, and that this activity is associated with modulation of neuroinflammation in spinal cord. 5. Gluco-Obtusifolin and its aglycone may be useful for the treatment of cognitive impairment, and that its beneficial effects are mediated, in part, by the enhancement of cholinergic signaling.Formula:C16H12O5Molecular weight:284.2635Obtusifolin
CAS:Obtusifolin is an antioxidant that combats diabetes, bone-resorption, diabetic retinopathy, pain, and cognitive decline.Formula:C16H12O5Purity:99.78% - 99.99%Color and Shape:SolidMolecular weight:284.2635Ref: TM-T4S0969
1mg56.00€1mL*10mM (DMSO)108.00€5mg114.00€10mg184.00€25mg356.00€50mg512.00€100mg734.00€2,8-Dihydroxy-1-methoxy-3-methylanthracene-9,10-dione
CAS:2,8-Dihydroxy-1-methoxy-3-methylanthracene-9,10-dioneFormula:C16H12O5Purity:98%Molecular weight:284.26Obtusifolin
CAS:Obtusifolin is a natural compound, which is a bioactive anthraquinone derivative extracted from the seeds of Cassia obtusifolia, a plant known for its medicinal properties. With its unique molecular structure, Obtusifolin exhibits significant anti-inflammatory and antioxidant activities. These properties are primarily due to its ability to modulate various biochemical pathways, including the inhibition of pro-inflammatory cytokines and the scavenging of reactive oxygen species.Formula:C16H12O5Purity:Min. 95%Molecular weight:284.26 g/mol
