CAS 481-42-5: Plumbagin
Description:Plumbagin, with the CAS number 481-42-5, is a naturally occurring naphthoquinone compound primarily derived from the roots of the plant *Plumbago* species, particularly *Plumbago zeylanica*. It is characterized by its yellow to orange crystalline appearance and has a molecular formula of C11H8O3. Plumbagin exhibits a range of biological activities, including antimicrobial, anticancer, and antioxidant properties, making it of interest in pharmacological research. The compound is known to interact with various cellular pathways, potentially influencing apoptosis and cell proliferation. Additionally, plumbagin has been studied for its ability to inhibit certain enzymes and its role in traditional medicine. Its solubility is generally higher in organic solvents than in water, which is a common trait for many organic compounds. However, due to its reactive nature, plumbagin can undergo oxidation and other chemical transformations, which may affect its stability and efficacy in various applications. Overall, plumbagin represents a significant compound in both natural product chemistry and medicinal research.
Formula:C11H8O3
InChI:InChI=1S/C11H8O3/c1-6-5-9(13)10-7(11(6)14)3-2-4-8(10)12/h2-5,12H,1H3
InChI key:InChIKey=VCMMXZQDRFWYSE-UHFFFAOYSA-N
SMILES:O=C1C=C(C(=O)C=2C=CC=C(O)C12)C
- Synonyms:
- 1,4-Naphthalenedione, 5-hydroxy-2-methyl-
- 1,4-Naphthoquinone, 5-hydroxy-2-methyl-
- 2-Methyl-5-hydroxy-1,4-naphthalenedione
- 2-Methyl-5-hydroxy-1,4-naphthoquinone
- 2-Methyljuglone
- 5-Hydroxy-2-Methylnaphthalene-1,4-Dione
- 5-Hydroxy-2-methyl-1,4-naphthalenedione
- 5-Hydroxy-2-methyl-1,4-naphthoquinone
- NSC 236613
- NSC 688284
- See more synonyms
- Plumbagin from Plumbago indica
- Plumbagin,95%
- Plumbagine
- Plumbagone
- Plumbagin
![5-Hydroxy-2-methyl-[1,4]naphthoquinone](https://static.cymitquimica.com/products/10/thumb/F032384.jpg)
