CAS 500715-03-7
:Benzenecarboximidamide,N,N''-[1,5-pentanediylbis(oxy-4,1-phenylene)]bis-
Description:
Benzenecarboximidamide, N,N''-[1,5-pentanediylbis(oxy-4,1-phenylene)]bis- is a chemical compound characterized by its complex structure, which includes a benzenecarboximidamide moiety linked to a bis(phenylene) unit through a pentanediyl spacer. This compound features functional groups such as amides and ether linkages, contributing to its potential reactivity and solubility properties. The presence of aromatic rings suggests that it may exhibit stability and unique electronic properties, making it of interest in various applications, including materials science and medicinal chemistry. The molecular structure may also influence its interactions with biological systems, potentially leading to specific pharmacological activities. Additionally, the compound's CAS number, 500715-03-7, allows for precise identification and retrieval of information in chemical databases. Overall, this compound's characteristics are defined by its functional groups, structural complexity, and potential applications in research and industry.
Formula:C31H32N4O2
InChI:InChI=1S/C31H32N4O2/c32-30(24-10-4-1-5-11-24)34-26-14-18-28(19-15-26)36-22-8-3-9-23-37-29-20-16-27(17-21-29)35-31(33)25-12-6-2-7-13-25/h1-2,4-7,10-21H,3,8-9,22-23H2,(H2,32,34)(H2,33,35)
InChI key:PETGITKEGWIZEL-UHFFFAOYSA-N
SMILES:C1=CC=C(C=C1)C(=NC2=CC=C(C=C2)OCCCCCOC3=CC=C(C=C3)N=C(C4=CC=CC=C4)N)N
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
IK1 inhibitor PA-6
CAS:IK1 inhibitor PA-6 (PA-6) is a selective and potent inhibitor of IK1 (KIR2.x ion-channel-carried inward rectifier current)(IC50 of 12-15 nM for human and mouseFormula:C31H32N4O2Purity:98.9%Color and Shape:SolidMolecular weight:492.61IK1 inhibitor PA-6
CAS:IK1 inhibitors have been shown to reduce the size of the atria in Sprague-Dawley rats. The effect is dose-dependent and reversible. This effect is caused by a reduction in the activation energy of the cardiac myocytes, which leads to a change in the kinetics of ion channels, as well as changes in intracellular calcium levels. IK1 inhibitors are polymers that contain an array of hydrophilic and hydrophobic segments. This polymer matrix has been shown to be effective for drug delivery to the heart, lungs, and other organs. IK1 inhibitor PA-6 has been shown to be effective for controlling water vapor transport from surfaces due to its high surface methodology and low viscosity properties.
Formula:C31H32N4O2Purity:Min. 95%Molecular weight:492.61 g/mol




