CAS 51059-44-0: Wogonoside
Description:Wogonoside, with the CAS number 51059-44-0, is a flavonoid glycoside derived from the plant Scutellaria baicalensis, commonly known as Chinese skullcap. It is characterized by its structure, which consists of a flavone backbone with a glucose moiety attached, contributing to its solubility and biological activity. Wogonoside exhibits a range of pharmacological properties, including anti-inflammatory, antioxidant, and anticancer effects, making it a subject of interest in medicinal chemistry and pharmacology. Its mechanism of action often involves the modulation of various signaling pathways and the inhibition of specific enzymes. Additionally, wogonoside has been studied for its potential neuroprotective effects and its ability to enhance the efficacy of certain chemotherapeutic agents. The compound is typically extracted from plant sources and can be analyzed using techniques such as high-performance liquid chromatography (HPLC) for purity and concentration assessment. Overall, wogonoside represents a promising natural product with significant therapeutic potential.
Formula:C22H20O11
InChI:InChI=1S/C22H20O11/c1-30-18-13(32-22-17(27)15(25)16(26)20(33-22)21(28)29)8-11(24)14-10(23)7-12(31-19(14)18)9-5-3-2-4-6-9/h2-8,15-17,20,22,24-27H,1H3,(H,28,29)/t15-,16-,17+,20-,22+/m0/s1
InChI key:InChIKey=LNOHXHDWGCMVCO-NTKSAMNMSA-N
SMILES:O=C(O)C1OC(OC2=CC(O)=C3C(=O)C=C(OC3=C2OC)C=4C=CC=CC4)C(O)C(O)C1O
- Synonyms:
- 5-Hydroxy-8-methoxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl β-<span class="text-smallcaps">D</span>-glucopyranosiduronic acid
- Beta-D-Glucopyranosiduronic Acid
- Glychionide B
- Oroxindin
- Wogonin 7-O-glucuronide
- Wogonin 7-O-β-<span class="text-smallcaps">D</span>-glucuronide
- Wogonin 7-O-β-<span class="text-smallcaps">D</span>-glucuronopyranoside
- Wogonin 7-glucuronide
- Wogonin 7-β-<span class="text-smallcaps">D</span>-glucuronide
- Wogonoside
- See more synonyms
- β-<span class="text-smallcaps">D</span>-Glucopyranosiduronic acid, 5-hydroxy-8-methoxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl
- β-D-Glucopyranosiduronic acid, 5-hydroxy-8-methoxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl
- Wogonin 7-β-D-glucuronide
- 5-Hydroxy-8-methoxy-4-oxo-2-phenyl-4H-chromen-7-yl hexopyranosiduronic acid
- 4H-1-benzopyran-4-one, 7-(hexopyranuronosyloxy)-5-hydroxy-8-methoxy-2-phenyl-
- 5-Hydroxy-8-methoxy-4-oxo-2-phenyl-4H-1-benzopyran-7-yl β-D-glucopyranosiduronic acid
