CAS 5127-64-0
:Gallocatechin gallate
Description:
Gallocatechin gallate (GCG) is a polyphenolic compound belonging to the flavonoid family, specifically a type of catechin. It is primarily found in green tea and is known for its antioxidant properties, which contribute to various health benefits. GCG is characterized by its ability to scavenge free radicals, thereby potentially reducing oxidative stress in biological systems. The compound has a molecular formula that reflects its complex structure, which includes multiple hydroxyl groups that enhance its reactivity and solubility in water. Gallocatechin gallate has been studied for its potential anti-inflammatory, anti-cancer, and cardiovascular protective effects. Additionally, it may play a role in metabolic regulation and weight management. Due to its bioactive properties, GCG is often explored in dietary supplements and functional foods. However, its stability can be affected by factors such as light, heat, and pH, which are important considerations in both research and application. Overall, GCG is a significant compound in the realm of nutritional biochemistry and pharmacology.
Formula:C22H18O11
InChI:InChI=1S/C22H18O11/c23-10-5-12(24)11-7-18(33-22(31)9-3-15(27)20(30)16(28)4-9)21(32-17(11)6-10)8-1-13(25)19(29)14(26)2-8/h1-6,18,21,23-30H,7H2/t18-,21+/m0/s1
InChI key:InChIKey=WMBWREPUVVBILR-GHTZIAJQSA-N
SMILES:O(C(=O)C1=CC(O)=C(O)C(O)=C1)[C@@H]2[C@H](OC=3C(C2)=C(O)C=C(O)C3)C4=CC(O)=C(O)C(O)=C4
Synonyms:- Gallocatechol gallate
- Benzoic acid, 3,4,5-trihydroxy-, 3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester, (2R-trans)-
- Gallic acid, ester with gallocatechol
- Gallocatechol, 3-gallate
- Benzoic acid, 3,4,5-trihydroxy-, (2R,3S)-3,4-dihydro-5,7-dihydroxy-2-(3,4,5-trihydroxyphenyl)-2H-1-benzopyran-3-yl ester
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
(+)-Gallocatechin gallate
CAS:(+)-Gallocatechin gallate analytical standard provided with chromatographic purity, to be used as reference material for qualitative determination.Formula:C22H18O11Purity:(HPLC) ≥95%Color and Shape:PowderMolecular weight:458.38Gallocatechin gallate
CAS:Gallocatechin gallate is a flavonoid compound that can be isolated from the plant Gelsemium elegans and has antiviral activity.Formula:C22H18O11Purity:98.28%Color and Shape:White SolidMolecular weight:458.37(+)-Gallocatechin gallate
CAS:(+)-Gallocatechin gallate is a polyphenolic compound, which is a specific type of catechin predominantly derived from green tea leaves, Camellia sinensis. It belongs to the flavonoid class of phytochemicals, known for their diverse biological activities. The compound exhibits potent antioxidant properties by scavenging free radicals and chelating metal ions, thereby reducing oxidative stress. It also modulates various signaling pathways involved in inflammation and cell proliferation.
Formula:C22H18O11Purity:Min. 98 Area-%Color and Shape:White PowderMolecular weight:458.37 g/mol




