CAS 53159-92-5
:1,2,3,4-cyclobutanetetracarboxylic acid
Description:
1,2,3,4-Cyclobutanetetracarboxylic acid, with the CAS number 53159-92-5, is a cyclic dicarboxylic acid characterized by its four carboxylic acid functional groups attached to a cyclobutane ring. This compound is notable for its unique structural configuration, which contributes to its chemical reactivity and potential applications in organic synthesis and materials science. The presence of multiple carboxylic acid groups enhances its acidity and solubility in polar solvents, making it useful in various chemical reactions, including esterification and amidation. Additionally, the cyclic nature of the molecule can influence its conformational stability and interactions with other molecules. Its derivatives may exhibit interesting properties, making it a subject of interest in research related to pharmaceuticals and polymer chemistry. However, due to its complex structure, the synthesis and handling of this compound require careful consideration of safety and environmental factors. Overall, 1,2,3,4-cyclobutanetetracarboxylic acid represents a fascinating example of a multifunctional organic compound with diverse potential applications.
Formula:C8H8O8
InChI:InChI=1/C8H8O8/c9-5(10)1-2(6(11)12)4(8(15)16)3(1)7(13)14/h1-4H,(H,9,10)(H,11,12)(H,13,14)(H,15,16)
SMILES:C1(C(C(C1C(=O)O)C(=O)O)C(=O)O)C(=O)O
Synonyms:- Cyclobutane tetracarboxylic acid
- Cyclobutane-1,2,3,4-Tetracarboxylic Acid
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
1,2,3,4-Cyclobutanetetracarboxylic Acid
CAS:Formula:C8H8O8Purity:>98.0%(GC)(T)Color and Shape:White to Light yellow powder to crystalMolecular weight:232.141,2,3,4-Cyclobutanetetracarboxylic Acid
CAS:1,2,3,4-Cyclobutanetetracarboxylic AcidFormula:C8H8O8Purity:95%Molecular weight:232.1441,2,3,4-Cyclobutanetetracarboxylic acid
CAS:Formula:C8H8O8Purity:95%Color and Shape:SolidMolecular weight:232.14431,2,3,4-Cyclobutanetetracarboxylic acid
CAS:Cyclobutane tetracarboxylic acid (CBT) is an organic compound that can be obtained by the efficient method of thermal cracking. It is a colorless solid with a melting point of about 175°C. The CBT molecule contains four cyclohexane rings, two alkylthio groups, and one chlorine atom. This chemical is used in the production of polyhedral oligomeric silsesquioxanes, which are particles with a high thermal expansion coefficient and light emission properties. CBT has been found to have chloride-containing compounds in its structure. When heated to high temperatures, these compounds decompose and produce gaseous products such as hydrogen chloride and hydrogen bromide.Formula:C8H8O8Purity:Min. 95%Color and Shape:PowderMolecular weight:232.14 g/mol1,2,3,4-Cyclobutanetetracarboxylic Acid
CAS:Controlled ProductApplications 1,2,3,4-Cyclobutanetetracarboxylic Acid is a reagent used in the preparation of cobalt cyclobutanetetracarboxylate polymer.
References Diaz-Gallifa, P., et al.: Inorg.Chem., 53, 5674 (2014)Formula:C8H8O8Color and Shape:NeatMolecular weight:232.14






