CAS 5544-60-5
:1-(benzyloxy)-4-(bromomethyl)benzene
Description:
1-(Benzyloxy)-4-(bromomethyl)benzene, with the CAS number 5544-60-5, is an organic compound characterized by its aromatic structure. It features a benzene ring substituted with a benzyloxy group and a bromomethyl group at the para position. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and specific conditions. It is known for its reactivity due to the presence of the bromomethyl group, which can undergo nucleophilic substitution reactions, making it useful in various organic synthesis applications. The benzyloxy group enhances the compound's solubility in organic solvents and can also participate in further chemical transformations. Additionally, this compound may exhibit moderate to low toxicity, and appropriate safety measures should be taken when handling it. Its applications can range from intermediates in pharmaceuticals to materials science, depending on the specific reactions it undergoes. As with many organic compounds, proper storage and handling are essential to maintain its stability and prevent degradation.
Formula:C14H13BrO
InChI:InChI=1/C14H13BrO/c15-10-12-6-8-14(9-7-12)16-11-13-4-2-1-3-5-13/h1-9H,10-11H2
SMILES:c1ccc(cc1)COc1ccc(cc1)CBr
Synonyms:- Benzene, 1-(Bromomethyl)-4-(Phenylmethoxy)-
- Benzyl 4-(bromomethyl)phenyl ether
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
4-(Benzyloxy)benzyl bromide
CAS:4-(Benzyloxy)benzyl bromideFormula:C14H13BrOPurity:97%Molecular weight:277.156421-(Benzyloxy)-4-(bromomethyl)benzene
CAS:Formula:C14H13BrOPurity:97%Color and Shape:SolidMolecular weight:277.15641-(Benzyloxy)-4-(bromomethyl)benzene
CAS:Formula:C14H13BrOPurity:98%Color and Shape:SolidMolecular weight:277.1611-(Benzyloxy)-4-(bromomethyl)benzene
CAS:1-(Benzyloxy)-4-(bromomethyl)benzeneFormula:C14H13BrOPurity:97%Molecular weight:277.164-Benzyloxybenzylbromide
CAS:4-Benzyloxybenzylbromide is a carboxylate that has been shown to inhibit the activity of aromatase. It binds covalently to the heme group, which is an important cofactor in the catalytic process. 4-Benzyloxybenzylbromide inhibits the activity of aromatase by enediol formation and stereoselective binding to the active site. This inhibitor has been shown to have potent inhibitory effects against cancer cells in vitro and in vivo.
Formula:C14H13BrOPurity:Min. 95%Color and Shape:PowderMolecular weight:277.16 g/mol




