CAS 574-84-5
:Fraxetin
Description:
Fraxetin, with the CAS number 574-84-5, is a naturally occurring compound classified as a coumarin derivative. It is primarily extracted from the bark of the Fraxinus species, commonly known as ash trees. This compound is characterized by its aromatic properties and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial effects. Fraxetin exhibits a phenolic structure, which contributes to its reactivity and interaction with various biological systems. In terms of solubility, it is generally soluble in organic solvents but has limited solubility in water. The compound has garnered interest in pharmacological research due to its potential therapeutic applications, particularly in traditional medicine. Additionally, fraxetin's role in plant defense mechanisms and its ecological significance in the environment are areas of ongoing study. Overall, fraxetin represents a fascinating subject in both natural product chemistry and medicinal research, highlighting the intersection of plant-derived compounds and their potential health benefits.
Formula:C10H8O5
InChI:InChI=1S/C10H8O5/c1-14-6-4-5-2-3-7(11)15-10(5)9(13)8(6)12/h2-4,12-13H,1H3
InChI key:InChIKey=HAVWRBANWNTOJX-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC(OC)=C1O)C=CC(=O)O2
Synonyms:- 2H-1-Benzopyran-2-one, 7,8-dihydroxy-6-methoxy-
- 6-Methoxy-7,8-dihydroxycoumarin
- 7,8-Dihydroxy-6-methoxy-2H-1-benzopyran-2-one
- Coumarin, 7,8-dihydroxy-6-methoxy-
- Fratexin
- Fraxetin
- Fraxetol
- 7,8-Dihydroxy-6-methoxycoumarin
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 11 products.
Fraxetin
CAS:Fraxetin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C10H8O5Purity:(HPLC) ≥99%Color and Shape:PowderMolecular weight:208.172H-1-Benzopyran-2-one, 7,8-dihydroxy-6-methoxy-
CAS:Formula:C10H8O5Purity:98%Color and Shape:SolidMolecular weight:208.1675Fraxetin
CAS:Fraxetin (7,8-dihydroxy-6-methoxy coumarin) has dual-antioxidative ,hepatoprotective and antihyperglycemic functions, it shows potent protective effects againstFormula:C10H8O5Purity:98% - 99.59%Color and Shape:Light Yellow Crystalline FlakesMolecular weight:208.17Fraxetin
CAS:LactoneFormula:C10H8O5Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:208.17Fraxetin
CAS:<p>Fraxetin is a coumarin compound, which is a type of secondary metabolite commonly found in plants. It is principally derived from sources such as Fraxinus rhynchophylla and other related species. Fraxetin functions through various biological mechanisms, including antioxidant, anti-inflammatory, and neuroprotective activities. It accomplishes this by scavenging free radicals, modulating inflammatory pathways, and inhibiting specific enzymes associated with oxidative stress.</p>Formula:C10H8O5Purity:Min. 95%Color and Shape:PowderMolecular weight:208.17 g/mol7,8-Dihydroxy-6-methoxy-2H-chromen-2-one
CAS:Formula:C10H8O5Purity:98%Color and Shape:Liquid, No data available.Molecular weight:208.169Fraxetin
CAS:<p>Fraxetin is a chemical compound known as a coumarin derivative, which is a natural product primarily sourced from various plant species. As a member of the coumarin family, fraxetin is often extracted from the roots, bark, and leaves of plant sources like Fraxinus species and other related flora. The compound operates through an array of biochemical pathways, prominently exhibiting antioxidant and anti-inflammatory properties. It acts by scavenging free radicals and modulating oxidative stress-related pathways, while also influencing the expression of various inflammatory cytokines.</p>Formula:C10H8O5Molecular weight:208.17 g/molRef: 3D-Q-100662
1gTo inquire5gTo inquire10gTo inquire500mgTo inquire2500mgTo inquire-Unit-ggTo inquire
