CAS 574-84-5
:Fraxetin
Description:
Fraxetin, with the CAS number 574-84-5, is a naturally occurring compound classified as a coumarin derivative. It is primarily extracted from the bark of the Fraxinus species, commonly known as ash trees. This compound is characterized by its aromatic properties and is known for its potential biological activities, including antioxidant, anti-inflammatory, and antimicrobial effects. Fraxetin exhibits a phenolic structure, which contributes to its reactivity and interaction with various biological systems. In terms of solubility, it is generally soluble in organic solvents but has limited solubility in water. The compound has garnered interest in pharmacological research due to its potential therapeutic applications, particularly in traditional medicine. Additionally, fraxetin's role in plant defense mechanisms and its ecological significance in the environment are areas of ongoing study. Overall, fraxetin represents a fascinating subject in both natural product chemistry and medicinal research, highlighting the intersection of plant-derived compounds and their potential health benefits.
Formula:C10H8O5
InChI:InChI=1S/C10H8O5/c1-14-6-4-5-2-3-7(11)15-10(5)9(13)8(6)12/h2-4,12-13H,1H3
InChI key:InChIKey=HAVWRBANWNTOJX-UHFFFAOYSA-N
SMILES:OC1=C2C(=CC(OC)=C1O)C=CC(=O)O2
Synonyms:- 2H-1-Benzopyran-2-one, 7,8-dihydroxy-6-methoxy-
- 6-Methoxy-7,8-dihydroxycoumarin
- 7,8-Dihydroxy-6-methoxy-2H-1-benzopyran-2-one
- Coumarin, 7,8-dihydroxy-6-methoxy-
- Fratexin
- Fraxetin
- Fraxetol
- 7,8-Dihydroxy-6-methoxycoumarin
Filter by
Purity percentage
0
100
|
0
|
50
|
90
|
95
|
100
Found 13 products.
- Lower prices
- Higher prices
- Lower purities
- Higher purities
- Faster estimated delivery
Fraxetin
CAS:Fraxetin analytical standard provided with w/w absolute assay, to be used for quantitative titration.Formula:C10H8O5Purity:(HPLC) ≥99%Color and Shape:PowderMolecular weight:208.17Fraxetin (Standard)
CAS:Fraxetin (Standard) is a reference standard for research and analysis in studies involving Fraxetin. Fraxetin (7,8-dihydroxy-6-methoxy coumarin) has dual-antioxidative ,hepatoprotective and antihyperglycemic functions, it shows potent protective effects against CCl4 induced oxidative stress and hepatic fibrosis, has a marked inhibitory effect on S.aureus proliferation. It increased the level of Nrf2/ARE, and HO-1, inhibit the formation of ROS, cytochrome c release, activation of caspase-3 and 9, and suppressed the up-regulation of Bax.Formula:C10H8O5Molecular weight:208.1675Fraxetin
CAS:Fraxetin (7,8-dihydroxy-6-methoxy coumarin) has dual-antioxidative ,hepatoprotective and antihyperglycemic functions, it shows potent protective effects againstFormula:C10H8O5Purity:98% - 99.84%Color and Shape:Light Yellow Crystalline FlakesMolecular weight:208.1675Fraxetin
CAS:7,8-Dihydroxy-6-methoxy-2H-chromen-2-oneFormula:C10H8O5Purity:95%Molecular weight:208.17Fraxetin
CAS:LactoneFormula:C10H8O5Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:208.177,8-Dihydroxy-6-methoxy-2H-chromen-2-one
CAS:Formula:C10H8O5Purity:98%Color and Shape:LiquidMolecular weight:208.169Fraxetin
CAS:Fraxetin is a coumarin compound, which is a type of secondary metabolite commonly found in plants. It is principally derived from sources such as Fraxinus rhynchophylla and other related species. Fraxetin functions through various biological mechanisms, including antioxidant, anti-inflammatory, and neuroprotective activities. It accomplishes this by scavenging free radicals, modulating inflammatory pathways, and inhibiting specific enzymes associated with oxidative stress.Formula:C10H8O5Purity:Min. 95%Color and Shape:PowderMolecular weight:208.17 g/molRef: 3D-FD34754
Discontinued product
