CymitQuimica logo

CAS 5794-28-5

:

Calcium oxalate monohydrate

Description:
Calcium oxalate monohydrate, with the CAS number 5794-28-5, is an inorganic compound that occurs as a white crystalline solid. It is the monohydrate form of calcium oxalate, which is a calcium salt of oxalic acid. This compound is characterized by its relatively low solubility in water, making it significant in biological systems, particularly in the formation of kidney stones. Calcium oxalate monohydrate is often found in various plants and is a key component in the mineral composition of certain fruits and vegetables. The compound exhibits a monoclinic crystal system and can be identified by its distinctive morphology under a microscope. In terms of chemical properties, it can react with acids to release oxalic acid and calcium ions. Its stability and low solubility are important in both environmental and physiological contexts, influencing calcium metabolism and the formation of precipitates in various settings. Overall, calcium oxalate monohydrate plays a crucial role in both natural processes and industrial applications.
Formula:C2CaO4·
InChI:InChI=1S/C2H2O4.Ca.H2O/c3-1(4)2(5)6;;/h(H,3,4)(H,5,6);;1H2/q;+2;/p-2
InChI key:LQHWSGSWNOHVHO-UHFFFAOYSA-L
SMILES:C(=O)(C(=O)[O-])[O-].O.[Ca+2]
Synonyms:
  • Ethanedioic acid, calcium salt (1:1), monohydrate
  • Unii-4Pp86Kk527
Found 10 products.