CAS 57966-95-7: Cymoxanil
Description:Cymoxanil is a chemical compound primarily used as a fungicide in agriculture, particularly for the control of various fungal diseases in crops. It belongs to the class of compounds known as anilines and is characterized by its ability to inhibit fungal growth by interfering with cellular respiration. Cymoxanil is typically applied to crops such as potatoes and tomatoes to protect against pathogens like late blight and downy mildew. The substance is known for its systemic properties, allowing it to be absorbed by plants and provide protection from within. It is generally considered to have low toxicity to humans and animals, making it a safer option compared to some other fungicides. Cymoxanil is often used in combination with other fungicides to enhance its efficacy and broaden the spectrum of disease control. Its environmental impact is also a consideration, as it is subject to regulations regarding its use and application to minimize potential effects on non-target organisms and ecosystems.
Formula:C7H10N4O3
InChI:InChI=1S/C7H10N4O3/c1-3-9-7(13)10-6(12)5(4-8)11-14-2/h3H2,1-2H3,(H2,9,10,12,13)
InChI key:InChIKey=XERJKGMBORTKEO-UHFFFAOYSA-N
SMILES:N#CC(=NOC)C(=O)NC(=O)NCC
- Synonyms:
- (2E)-2-cyano-N-(ethylcarbamoyl)-2-(methoxyimino)ethanamide
- (2Z)-2-cyano-N-(ethylcarbamoyl)-2-(methoxyimino)ethanamide
- 1-(2-Cyano-2-Methoxyiminoacetyl)-3-Ethylurea
- 1-Cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide
- 2-Cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)acetamide
- 2-Cyano-N-ethylcarbamoyl-2-methoxyiminoacetamide
- 2-cyano-N-(ethylcarbamoyl)-2-(methoxyimino)acetamide
- Acetamide, 2-cyano-N-[(ethylamino)carbonyl]-2-(methoxyimino)-
- Casparytin
- Curzate
- See more synonyms
- Dpx 3217
- Dpx 3217M
- Tosca MZ

Cymoxanil
Ref: 3B-C2657
5g | 52.00 € | ||
25g | 158.00 € |

Cymoxanil
Ref: TM-T37349
10mg | 49.00 € |

LC PestiMix 1 10 µg/mL in Acetonitrile
Ref: 04-A50000801AL
1ml | To inquire |

GB 23200.121-2021 Pesticide Mixture 10 50 µg/mL in Acetonitrile
Controlled ProductRef: 04-A50000730AL
1ml | To inquire |

Cymoxanil
Controlled ProductRef: 04-C11880000
100mg | 109.00 € |

Cymoxanil
Controlled ProductRef: TR-C988995
1g | 372.00 € | ||
10g | 1,602.00 € | ||
250mg | 261.00 € |

Cymoxanil
Ref: 3D-FC61343
2g | Discontinued | Request information | |
5g | Discontinued | Request information | |
10g | Discontinued | Request information | |
25g | Discontinued | Request information | |
50g | Discontinued | Request information |