CAS 58546-34-2
:Hemslecin A
Description:
Hemslecin A is a natural product classified as a secondary metabolite, specifically a type of alkaloid. It is derived from certain fungal species and is known for its complex molecular structure, which includes multiple functional groups that contribute to its biological activity. The compound exhibits notable antimicrobial properties, making it of interest in pharmaceutical research for potential therapeutic applications. Hemslecin A has been studied for its effects on various biological systems, including its ability to inhibit the growth of certain pathogens. Its chemical structure features a bicyclic framework, which is characteristic of many alkaloids, and it may interact with biological targets through various mechanisms, including enzyme inhibition or receptor modulation. Additionally, the compound's solubility and stability can vary depending on environmental conditions, influencing its bioavailability and efficacy. Overall, Hemslecin A represents a significant area of study within natural product chemistry, particularly in the search for new antimicrobial agents.
Formula:C32H50O8
InChI:InChI=1S/C32H50O8/c1-17(33)40-27(2,3)13-12-23(36)32(9,39)25-21(35)15-29(6)22-11-10-18-19(14-20(34)26(38)28(18,4)5)31(22,8)24(37)16-30(25,29)7/h10,19-22,25-26,34-35,38-39H,11-16H2,1-9H3/t19-,20+,21-,22+,25+,26-,29+,30-,31+,32+/m1/s1
InChI key:InChIKey=LKYNAQSYQLFTCM-GYXNDICUSA-N
SMILES:C[C@]12[C@@](C)([C@@]([C@@](C(CCC(OC(C)=O)(C)C)=O)(C)O)([C@H](O)C1)[H])CC(=O)[C@]3(C)[C@]2(CC=C4[C@]3(C[C@H](O)[C@@H](O)C4(C)C)[H])[H]
Synonyms:- (2β,3α,9β,10α,16α)-25-(Acetyloxy)-2,3,16,20-tetrahydroxy-9-methyl-19-norlanost-5-ene-11,22-dione
- 19-Norlanost-5-ene-11,22-dione, 25-(acetyloxy)-2,3,16,20-tetrahydroxy-9-methyl-, (2beta,3alpha,9beta,10alpha,16alpha)-
- 19-Norlanost-5-ene-11,22-dione, 25-(acetyloxy)-2,3,16,20-tetrahydroxy-9-methyl-, (2β,3α,9β,10α,16α)-
- 23,24-Dihydrocucurbitacin F 25-acetate
- 23,24-Dihydrocucurbitacin F-25-O-acetate
- 25-Acetoxy-23,24-dihydrocucurbitacin F
- 25-O-Acetyl-23,24-dihydrocucurbitacin F
- Cucurbitacin II<sub>a</sub>
- Dihydrocucurbitacin F 25-O-acetate
- Dihydrocucurbitacin Q1
- Hemslecin A
- estr-5-en-11-one, 17-[(1R)-5-(acetyloxy)-1-hydroxy-1,5-dimethyl-2-oxohexyl]-2,3,16-trihydroxy-4,4,9,14-tetramethyl-, (2beta,3alpha,9beta,10alpha,16alpha,17beta)-
- See more synonyms
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 7 products.
Cucurbitacin IIA
CAS:1.Formula:C32H50O8Purity:98.62% - 99.87%Color and Shape:SolidMolecular weight:562.73Hemslecin A
CAS:Carboxylic acid with alcohol functionFormula:C32H50O8Purity:≥ 95.0 % (HPLC)Color and Shape:PowderMolecular weight:562.75Cucurbitacin IIA
CAS:Controlled ProductCucurbitacin IIA is a triterpenoid compound, which is a type of secondary metabolite predominantly found in plants belonging to the Cucurbitaceae family. This compound is a naturally occurring substance that has been isolated from sources like various cucumbers and gourds. Its mode of action primarily involves the inhibition of the JAK-STAT signaling pathway, which is pivotal in cellular processes including proliferation, apoptosis, and immune response regulation.
Purity:Min. 95%






