CAS 58667-63-3
:Flamprop
Description:
Flamprop, with the CAS number 58667-63-3, is a chemical compound primarily used as a herbicide in agricultural applications. It belongs to the class of compounds known as phenoxypropionic acids, which are characterized by their ability to selectively control broadleaf weeds while being less harmful to grasses. Flamprop functions by inhibiting specific enzymes involved in plant growth, effectively disrupting the normal physiological processes of target weeds. This compound is typically applied to crops such as cereals and other grass species, providing effective weed management. In terms of physical properties, Flamprop is generally a solid at room temperature and has moderate solubility in organic solvents. Safety data indicates that, like many herbicides, it should be handled with care, following appropriate safety guidelines to minimize environmental impact and human exposure. Its use is regulated in many regions, necessitating adherence to local agricultural practices and guidelines to ensure safe and effective application.
Formula:C16H13ClFNO3
InChI:InChI=1S/C16H13ClFNO3/c1-10(16(21)22)19(12-7-8-14(18)13(17)9-12)15(20)11-5-3-2-4-6-11/h2-10H,1H3,(H,21,22)
InChI key:InChIKey=YQVMVCCFZCMYQB-UHFFFAOYSA-N
SMILES:N(C(=O)C1=CC=CC=C1)(C(C(O)=O)C)C2=CC(Cl)=C(F)C=C2
Synonyms:- 2-[Benzoyl(3-chloro-4-fluorophenyl)amino]propanoic acid
- 58667-63-3
- <span class="text-smallcaps">DL</span>-Alanine, N-benzoyl-N-(3-chloro-4-fluorophenyl)-
- Alanine, N-benzoyl-N-(3-chloro-4-fluorophenyl)-
- Flamprop
- Flamprop acid
- N-Benzoyl-N-(3-chlor-4-fluorphenyl)alanin
- DL-Alanine, N-benzoyl-N-(3-chloro-4-fluorophenyl)-
- N-Benzoyl-N-(3-chloro-4-fluorophenyl)alanine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 3 products.
Flamprop (free acid) 100 µg/mL in Acetonitrile
CAS:Formula:C16H13ClFNO3Color and Shape:Single SolutionMolecular weight:321.73Flamprop (free acid)
CAS:Controlled ProductFormula:C16H13ClFNO3Color and Shape:NeatMolecular weight:321.73

