CAS 5950-12-9
:Piperlonguminine
Description:
Piperlonguminine is an alkaloid derived from the plant Piper longum, commonly known as long pepper. It is characterized by its complex structure, which includes a piperidine ring and various functional groups that contribute to its biological activity. This compound is known for its potential pharmacological properties, including anti-inflammatory, analgesic, and anticancer effects. Piperlonguminine has been studied for its ability to modulate various signaling pathways, making it a subject of interest in medicinal chemistry and drug development. Additionally, it exhibits a range of biological activities, such as antimicrobial and antioxidant properties. The substance is typically found in the form of a white to off-white crystalline powder and is soluble in organic solvents. Its safety profile and toxicity are still under investigation, emphasizing the need for further research to fully understand its therapeutic potential and mechanisms of action. Overall, piperlonguminine represents a promising compound in the field of natural products and pharmacology.
Formula:C16H19NO3
InChI:InChI=1S/C16H19NO3/c1-12(2)10-17-16(18)6-4-3-5-13-7-8-14-15(9-13)20-11-19-14/h3-9,12H,10-11H2,1-2H3,(H,17,18)/b5-3+,6-4+
InChI key:InChIKey=WHAAPCGHVWVUEX-GGWOSOGESA-N
SMILES:C(=C/C=C/C(NCC(C)C)=O)\C=1C=C2C(=CC1)OCO2
Synonyms:- (2E,4E)-5-(1,3-Benzodioxol-5-yl)-N-(2-methylpropyl)-2,4-pentadienamide
- 2,4-Pentadienamide, 5-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)-, (2E,4E)-
- 2,4-Pentadienamide, 5-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)-, (E,E)-
- 2,4-pentadienamide, 5-(1,3-benzodioxol-5-yl)-N-(2-methylpropyl)-
- N-Isobutylpiperamide
- NSC 125178
- Piperamide, N-isobutyl-
- Piperlonguminin
- Piperlonguminine
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 8 products.
Piperlonguminine
CAS:Piperlonguminine is an alkaloid amide isolated from the Piper species.Formula:C16H19NO3Purity:99.27%Color and Shape:White SolidMolecular weight:273.33Ref: TM-TN2085
1mg47.00€2mg62.00€1mL*10mM (DMSO)88.00€5mg92.00€10mg147.00€25mg243.00€50mg353.00€100mg527.00€200mg750.00€Piperlonguminine
CAS:Oxygen-heterocyclic compoundFormula:C16H19NO3Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:273.33Piperlonguminine
CAS:Piperlonguminine is a bioactive compound, which is a natural alkaloid derived primarily from the fruit of Piper longum, a plant commonly found in South and Southeast Asia. Piperlonguminine acts through various biochemical pathways, notably influencing cellular processes related to inflammation, cancer cell proliferation, and apoptosis. It has been observed to interact with molecular targets, such as nuclear factor kappa B (NF-κB), contributing to its anti-inflammatory and anticancer activities.
Formula:C16H19NO3Purity:Min. 99.0 Area-%Color and Shape:PowderMolecular weight:273.33 g/molPiperlonguminine
CAS:(2E,4E)-5-(Benzo[d][1,3]dioxol-5-yl)-N-isobutylpenta-2,4-dienamideFormula:C16H19NO3Purity:99%Molecular weight:273.335-benzo[1,3]dioxol-5-yl-N-(2-methylpropyl)penta-2,4-dienamide
CAS:Formula:C16H19NO3Purity:98%Color and Shape:SolidMolecular weight:273.3270Ref: IN-DA00EBLZ
Discontinued product







