CAS 63223-57-4
:Valerylglucosamile; 98%
Description:
Valerylglucosamine, with the CAS number 63223-57-4, is a chemical compound characterized by its structure, which includes a glucosamine moiety linked to a valeryl group. This compound typically appears as a white to off-white solid and is soluble in polar solvents, reflecting its hydrophilic nature due to the presence of the amino and hydroxyl groups. Valerylglucosamine is often studied for its potential applications in biochemistry and pharmaceuticals, particularly in the context of glycosylation reactions and as a building block for more complex molecules. Its purity, often stated as 98%, indicates a high level of refinement, making it suitable for research and industrial applications. The compound may exhibit biological activity, potentially influencing metabolic pathways or serving as a substrate in enzymatic reactions. Safety data should be consulted for handling and storage, as with any chemical substance, to ensure proper laboratory practices are followed.
Formula:C11H21NO6
InChI:InChI=1/C11H21NO6/c1-2-3-4-7(14)12-8-10(16)9(15)6(5-13)18-11(8)17/h6,8-11,13,15-17H,2-5H2,1H3,(H,12,14)/t6-,8-,9-,10-,11?/m1/s1
SMILES:CCCCC(=N[C@@H]1[C@H]([C@@H]([C@@H](CO)OC1O)O)O)O
Synonyms:- N-n-Valeryl-D-glucosamile
- 2-deoxy-2-(pentanoylamino)-D-glucopyranose
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
N-Valeryl-D-glucosamine
CAS:Formula:C11H21NO6Purity:>98.0%(N)Color and Shape:White to Almost white powder to crystalMolecular weight:263.29N-Valeryl-D-glucosamine
CAS:N-Valeryl-D-glucosamineFormula:C11H21NO6Purity:>98.0%Molecular weight:263.29N-N-Valeryl-D-glucosamine
CAS:Formula:C11H21NO6Purity:98.0%Color and Shape:SolidMolecular weight:263.2875N-Valeryl-D-glucosamine
CAS:N-Valeryl-D-glucosamine is an aldol product of the condensation of acetone and formaldehyde. N-Valeryl-D-glucosamine is a bioactive molecule that has been shown to be synthesized by the c-glycosidic linkage of D-glucose molecules in bacteria and fungi. It is also found in plants, such as sugar cane and sugar beet. The synthesis of this molecule occurs through the aldol reaction, which involves the unactivated ketones (acetone). This compound can also be found in biomolecular chemistry, where it is used as a substrate for condensation reactions.
Formula:C11H21NO6Purity:Min. 95%Color and Shape:White PowderMolecular weight:263.29 g/mol





