CAS 64963-01-5: (D-ala2)-leucine enkephalin
Description:(D-Ala2)-leucine enkephalin is a synthetic peptide that belongs to the class of enkephalins, which are endogenous opioid peptides involved in pain modulation and various physiological processes. This compound is characterized by its specific amino acid sequence, which includes the substitution of D-alanine at the second position, enhancing its stability against enzymatic degradation compared to its natural counterparts. The peptide exhibits high affinity for opioid receptors, particularly the delta-opioid receptor, contributing to its analgesic properties. Its structure typically consists of five amino acids, and it is known for its role in neuropharmacology, where it can influence mood, pain perception, and stress response. Additionally, (D-Ala2)-leucine enkephalin is often studied for its potential therapeutic applications in pain management and addiction treatment. The compound is usually administered in research settings, and its effects are evaluated through various biochemical assays and behavioral studies. Overall, its unique characteristics make it a significant subject of interest in both basic and applied biomedical research.
Formula:C29H39N5O7
InChI:InChI=1/C29H39N5O7/c1-17(2)13-24(29(40)41)34-28(39)23(15-19-7-5-4-6-8-19)33-25(36)16-31-26(37)18(3)32-27(38)22(30)14-20-9-11-21(35)12-10-20/h4-12,17-18,22-24,35H,13-16,30H2,1-3H3,(H,31,37)(H,32,38)(H,33,36)(H,34,39)(H,40,41)/t18-,22+,23+,24+/m1/s1
- Synonyms:
- (D-Ala2)-Leu-Enkephalin
- H-Tyr-D-Ala-Gly-Phe-Leu-OH
- Tyrosylalanylglycylphenylalanylleucine
- L-tyrosyl-D-alanylglycyl-L-phenylalanyl-L-leucine
- Tyr-D-Ala-Gly-Phe-Leu