CAS 67905-19-5: Perfluorohexadecanoic acid
Description:Perfluorohexadecanoic acid (PFHxDA) is a perfluorinated carboxylic acid characterized by a long carbon chain, specifically consisting of 16 carbon atoms fully fluorinated. This compound is part of a larger class of perfluoroalkyl substances (PFAS), known for their unique properties, including high thermal stability, chemical resistance, and hydrophobicity. PFHxDA is typically a solid at room temperature and is insoluble in water due to its fluorinated structure, which imparts low surface energy. Its applications are primarily found in industrial processes, particularly in the production of water- and oil-repellent coatings. However, PFHxDA and other PFAS have raised environmental and health concerns due to their persistence in the environment and potential bioaccumulation. Studies have indicated that exposure to PFAS may be linked to various health effects, prompting regulatory scrutiny and research into safer alternatives. Overall, while PFHxDA exhibits useful properties for specific applications, its environmental impact necessitates careful management and consideration in usage.
Formula:C16HF31O2
InChI:InChI=1S/C16HF31O2/c17-2(18,1(48)49)3(19,20)4(21,22)5(23,24)6(25,26)7(27,28)8(29,30)9(31,32)10(33,34)11(35,36)12(37,38)13(39,40)14(41,42)15(43,44)16(45,46)47/h(H,48,49)
InChI key:InChIKey=OJMBMWRMTMHMSZ-UHFFFAOYSA-N
SMILES:O=C(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-Hentriacontafluorohexadecanoic acid
- Hentriacontafluorohexadecanoic Acid
- Hexadecanoic acid, 2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,13,13,14,14,15,15,16,16,16-hentriacontafluoro-
- Hexadecanoic acid, hentriacontafluoro-
- PFHxDA
- Perfluoropalmitic acid
- Perfluorohexadecanoic acid
