CAS 68259-12-1: Perfluorononanesulfonic acid
Description:Perfluorononanesulfonic acid (PFNS) is a synthetic perfluoroalkyl substance characterized by a long carbon chain with a sulfonic acid functional group. It belongs to a broader class of per- and polyfluoroalkyl substances (PFAS), which are known for their unique properties, including high thermal and chemical stability, as well as water and oil repellency. PFNS is typically used in various industrial applications, including surfactants, coatings, and as a processing aid in the manufacture of fluoropolymers. Its structure imparts significant hydrophobic and lipophobic characteristics, making it effective in repelling water and oils. However, like many PFAS, PFNS is persistent in the environment and can accumulate in living organisms, raising concerns regarding its potential health effects and environmental impact. Regulatory scrutiny has increased due to the potential for bioaccumulation and toxicity, leading to ongoing research into its behavior in the environment and its effects on human health. As a result, the use and disposal of PFNS and similar substances are subject to increasing regulation and oversight.
Formula:C9HF19O3S
InChI:InChI=1S/C9HF19O3S/c10-1(11,2(12,13)4(16,17)6(20,21)8(24,25)26)3(14,15)5(18,19)7(22,23)9(27,28)32(29,30)31/h(H,29,30,31)
InChI key:InChIKey=MNEXVZFQQPKDHC-UHFFFAOYSA-N
SMILES:O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Nonadecafluoro-1-nonanesulfonic acid
- 1-Nonanesulfonic Acid, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Nonadecafluoro-
- Perfluorononanesulfonic acid
- PFNS
- 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-Nonadecafluorononane-1-sulfonic acid
