CAS: 705260-08-8 - Vorapaxar Sulfate
Formula:C29H35FN2O8S
InChI:InChI=1S/C29H33FN2O4.H2O4S/c1-3-35-29(34)32-23-10-11-24-20(14-23)15-26-27(17(2)36-28(26)33)25(24)12-9-22-8-7-19(16-31-22)18-5-4-6-21(30)13-18;1-5(2,3)4/h4-9,12-13,16-17,20,23-27H,3,10-11,14-15H2,1-2H3,(H,32,34);(H2,1,2,3,4)/b12-9+;/t17-,20+,23-,24-,25+,26-,27+;/m1./s1
InChI key:InChIKey=NQRYCIGCIAWEIC-CKLVGUEFSA-N
SMILES:O=C(OCC)NC1CCC2C(C=CC=3N=CC(=CC3)C4=CC=CC(F)=C4)C5C(OC(=O)C5CC2C1)C.O=S(=O)(O)O
- Synonyms:
- Carbamic acid, N-[(1R,3aR,4aR,6R,8aR,9S,9aS)-9-[(1E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]dodecahydro-1-methyl-3-oxonaphtho[2,3-c]furan-6-yl]-, ethyl ester, sulfate (1:1)
- Carbamic acid, [(1R,3aR,4aR,6R,8aR,9S,9aS)-9-[(1E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]dodecahydro-1-methyl-3-oxonaphtho[2,3-c]furan-6-yl]-, ethyl ester, sulfate (1:1)
- Sch 530348
- Vorapaxar sulphate
- Zontivity
Carbamic acid, N-[(1R,3aR,4aR,6R,8aR,9S,9aS)-9-[(1E)-2-[5-(3-fluorophenyl)-2-pyridinyl]ethenyl]dodecahydro-1-methyl-3-oxonaphtho[2,3-c]furan-6-yl]-, ethyl ester, sulfate (1:1)
Ref: AN-AG0039N9
1mg | To inquire | |
2mg | To inquire | |
5mg | To inquire | |
10mg | To inquire | |
25mg | To inquire | |
50mg | To inquire | |
100mg | To inquire | |
500mg | To inquire |
Vorapaxar Sulfate
Controlled ProductRef: 86-MM3735.00
50mg | 3,069.00 € |
Ref: 4Z-V-050001
10mg | To inquire | |
25mg | To inquire | |
50mg | To inquire | |
100mg | To inquire |
Vorapaxar sulfate
Ref: TM-T3098
1mg | 38.00 € | |
2mg | 49.00 € | |
5mg | 78.00 € | |
10mg | 118.00 € | |
25mg | 207.00 € | |
50mg | 346.00 € | |
100mg | 516.00 € | |
500mg | 1,133.00 € | |
1ml*10 (DMSO) | 97.00 € |
Ref: 4Z-V-050002
10mg | To inquire | |
25mg | To inquire | |
50mg | To inquire | |
100mg | To inquire |
Vorapaxar Sulfate
Controlled ProductRef: TR-V758200
25mg | 315.00 € | |
50mg | 568.00 € |
Fosfomycin-sucrose Ether Disodium Salt
Controlled ProductRef: TR-F727501
5mg | 15,221.00 € |
Ref: TR-V758202
25mg | 34,511.00 € |
Vorapaxar sulfate
Ref: 3D-FV28721
1mg | To inquire | |
2mg | To inquire |