CAS 7390-78-5
:tyr-tyr-tyr
Description:
The chemical substance known as "tyr-tyr-tyr," with the CAS number 7390-78-5, is a synthetic peptide composed of three tyrosine residues linked together. Tyrosine is an amino acid that plays a crucial role in the synthesis of neurotransmitters and hormones. This tripeptide exhibits characteristics typical of tyrosine, including its aromatic nature, which contributes to its ability to absorb ultraviolet light. The presence of hydroxyl groups in the side chains of tyrosine allows for potential interactions such as hydrogen bonding, influencing its solubility and reactivity. Additionally, the peptide may exhibit antioxidant properties due to the presence of the phenolic hydroxyl group in tyrosine, which can scavenge free radicals. In biological systems, such peptides can serve various functions, including acting as signaling molecules or precursors for larger proteins. Overall, tyr-tyr-tyr is of interest in biochemical research and potential therapeutic applications, particularly in the study of neurochemistry and metabolic pathways.
Formula:C27H29N3O7
InChI:InChI=1S/C27H29N3O7/c28-22(13-16-1-7-19(31)8-2-16)25(34)29-23(14-17-3-9-20(32)10-4-17)26(35)30-24(27(36)37)15-18-5-11-21(33)12-6-18/h1-12,22-24,31-33H,13-15,28H2,(H,29,34)(H,30,35)(H,36,37)/t22-,23-,24-/m0/s1
InChI key:RMRFSFXLFWWAJZ-HJOGWXRNSA-N
SMILES:C1=CC(=CC=C1C[C@@H](C(=O)N[C@@H](CC2=CC=C(C=C2)O)C(=O)N[C@@H](CC3=CC=C(C=C3)O)C(=O)O)N)O
Synonyms:- H-Tyr-Tyr-Tyr-OH
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
H-Tyr-Tyr-Tyr-OH
CAS:The bitter taste of tri-tyrosine, YYY, is due to its marked hydrophobicity. Narai-Kanayama and Aso showed that Tyr-Tyr (G-3480) and Tyr-Tyr-Tyr efficiently inhibit angiotensin I-converting enzyme (ACE) from rabbit lung, their IC₅₀ values were 34 μM and 51 μM, respectively. These two tyrosine peptides exhibited a mix of competitive and noncompetitive inhibitions.Formula:C27H29N3O7Purity:> 99%Color and Shape:WhiteMolecular weight:507.54L-Tyrosine, L-tyrosyl-L-tyrosyl-
CAS:Formula:C27H29N3O7Purity:98%Color and Shape:SolidMolecular weight:507.5351(S)-2-((S)-2-((S)-2-Amino-3-(4-hydroxyphenyl)propanamido)-3-(4-hydroxyphenyl)propanamido)-3-(4-hydroxyphenyl)propanoic acid
CAS:(S)-2-((S)-2-((S)-2-Amino-3-(4-hydroxyphenyl)propanamido)-3-(4-hydroxyphenyl)propanamido)-3-(4-hydroxyphenyl)propanoic acidPurity:≥95%Molecular weight:507.54g/molH-Tyr-Tyr-Tyr-OH
CAS:H-Tyr-Tyr-Tyr-OH is a synthetic compound that has been used to study the mechanism of lactoperoxidase. Lactoperoxidase is an enzyme that catalyzes the oxidation of thiocyanate to form hypothiocyanite, hydrogen peroxide, and a hydroxy group. The hydroxy group is formed by the reaction of two molecules of hydrogen peroxide with a molecule of thiocyanate. This reaction produces an oxygen atom, which then reacts with water to produce an acid. H-Tyr-Tyr-Tyr-OH has been shown to be a substrate for lactoperoxidase in horse serum and bovine serum. It has also been found to react with oxygen at neutral pH levels, forming a product that absorbs ultraviolet light at 280 nm.
Formula:C27H29N3O7Purity:Min. 95%Color and Shape:PowderMolecular weight:507.54 g/mol




