CymitQuimica logo

CAS 78755-80-3

:

1H-1,4-Benzodiazepine-2,5-dione, 7-fluoro-3,4-dihydro-4-methyl-

Description:
1H-1,4-Benzodiazepine-2,5-dione, 7-fluoro-3,4-dihydro-4-methyl- is a chemical compound belonging to the benzodiazepine class, which is characterized by a fused benzene and diazepine ring structure. This specific compound features a fluorine atom at the 7-position and a methyl group at the 4-position of the benzodiazepine core, contributing to its unique chemical properties and potential biological activity. The presence of the 2,5-dione functional groups indicates that it may exhibit reactivity typical of diketones, potentially influencing its interactions in biological systems. Benzodiazepines are known for their psychoactive effects, often acting as anxiolytics, sedatives, or muscle relaxants, although the specific pharmacological profile of this compound would require further investigation. Its CAS number, 78755-80-3, allows for precise identification in chemical databases. Overall, this compound's structural features suggest it may have applications in medicinal chemistry, particularly in the development of new therapeutic agents.
Formula:C10H9FN2O2
InChI:InChI=1S/C10H9FN2O2/c1-13-5-9(14)12-8-3-2-6(11)4-7(8)10(13)15/h2-4H,5H2,1H3,(H,12,14)
InChI key:BKHGZIQXTHAVNJ-UHFFFAOYSA-N
SMILES:CN1CC(=O)NC2=C(C1=O)C=C(C=C2)F
Synonyms:
  • 7-Fluoro-3,4-dihydro-4-methyl-1H-1,4-benzodiazepine-2,5-dione
  • 7-Fluoro-3,4-dihydro-4-methyl-1H-benzo[e][1,4]diazepine-2,5-dione
Found 11 products.