CymitQuimica logo

CAS 79037-36-8

:

(8R,13S,17R)-2,4,17-trideuterio-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16,17-triol

Description:
The chemical substance with the name "(8R,13S,17R)-2,4,17-trideuterio-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthrene-3,16,17-triol" and CAS number "79037-36-8" is a steroid derivative characterized by its complex polycyclic structure. This compound features multiple chiral centers, which contribute to its stereochemistry, specifically denoted by the (8R,13S,17R) configuration. The presence of deuterium atoms indicates that it is a labeled compound, often used in research to trace metabolic pathways or in studies involving isotopic effects. The hydroxyl groups (-OH) at positions 3, 16, and 17 suggest that it has significant polar characteristics, which may influence its solubility and reactivity. The octahydro structure indicates that it is saturated, which typically enhances stability compared to unsaturated analogs. Overall, this compound is of interest in fields such as medicinal chemistry and biochemistry, particularly in studies related to steroid metabolism and function.
Formula:C18H21D3O3
InChI:InChI=1/C18H24O3/c1-18-7-6-13-12-5-3-11(19)8-10(12)2-4-14(13)15(18)9-16(20)17(18)21/h3,5,8,13-17,19-21H,2,4,6-7,9H2,1H3/t13?,14-,15?,16?,17+,18+/m1/s1/i3D,8D,17D
Found 8 products.