CAS 79780-39-5: 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecane-1-sulfonic acid
Description:1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluorododecane-1-sulfonic acid, commonly referred to as a perfluorinated compound, is characterized by its long carbon chain and multiple fluorine substituents, which impart unique properties. This compound features a sulfonic acid functional group, contributing to its high polarity and solubility in water, making it useful in various applications, including surfactants and emulsifiers. The extensive fluorination results in exceptional thermal and chemical stability, as well as low surface tension, which enhances its effectiveness in reducing surface energy. Additionally, the presence of the sulfonic acid group allows for strong interactions with polar substances, further broadening its utility in industrial applications. However, due to environmental concerns associated with perfluorinated compounds, including potential persistence and bioaccumulation, regulatory scrutiny has increased. Overall, this compound exemplifies the balance between functional performance and environmental impact in the field of chemistry.
Formula:C12HF25O3S
InChI:InChI=1S/C12HF25O3S/c13-1(14,3(17,18)5(21,22)7(25,26)9(29,30)11(33,34)35)2(15,16)4(19,20)6(23,24)8(27,28)10(31,32)12(36,37)41(38,39)40/h(H,38,39,40)
InChI key:InChIKey=CFCRODHVHXGTPC-UHFFFAOYSA-N
SMILES:O=S(=O)(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-Pentacosafluoro-1-dodecanesulfonic acid
- 1-Dodecanesulfonic acid, 1,1,2,2,3,3,4,4,5,5,6,6,7,7,8,8,9,9,10,10,11,11,12,12,12-pentacosafluoro-
- 279-259-9
- Perfluorododecanesulfonic acid
