CAS 80983-34-2: Albendazole-2-aminosulfone
Description:Albendazole-2-aminosulfone, identified by the CAS number 80983-34-2, is a chemical compound that serves as a metabolite of the widely used anthelmintic drug albendazole. This compound is characterized by its sulfone functional group, which contributes to its biological activity. It is typically a white to off-white solid, exhibiting moderate solubility in water and organic solvents. The presence of the amino and sulfone groups in its structure enhances its reactivity and potential interactions with biological targets. Albendazole-2-aminosulfone is primarily studied for its role in the pharmacological effects of albendazole, particularly in the treatment of parasitic infections. Its mechanism of action involves the inhibition of microtubule polymerization, which disrupts cellular processes in parasites. Additionally, this compound may exhibit varying degrees of toxicity and efficacy depending on the specific parasitic organism and the dosage used. Overall, albendazole-2-aminosulfone is significant in the context of drug metabolism and therapeutic applications in parasitology.
Formula:C10H13N3O2S
InChI:InChI=1S/C10H13N3O2S/c1-2-5-16(14,15)7-3-4-8-9(6-7)13-10(11)12-8/h3-4,6H,2,5H2,1H3,(H3,11,12,13)
InChI key:InChIKey=WTPBIYSMFKUQKY-UHFFFAOYSA-N
SMILES:O=S(=O)(C=1C=CC=2N=C(N)NC2C1)CCC
- Synonyms:
- 1H-Benzimidazol-2-amine, 5-(propylsulfonyl)-
- 1H-Benzimidazol-2-amine, 6-(propylsulfonyl)-
- 2-Amino-5-1H-propylsulfonylbenzimidazole
- 2-Amino-5-n-propylsulphonylbenzimidazole
- 2-Aminoalbendazole sulfone
- 5-Propylsulfonyl-1H-benzimidazol-2-amine
- 6-(propylsulfonyl)-1H-benzimidazol-2-amine
- 6-Propylsulfonyl-1H-benzoimidazol-2-amine
- Albendazole-2-aminosulfone
- Skf 81038
- See more synonyms
