CAS 81-20-9: 2,6-Dimethylnitrobenzene
Description:2,6-Dimethylnitrobenzene, with the CAS number 81-20-9, is an aromatic nitro compound characterized by the presence of two methyl groups and a nitro group attached to a benzene ring. Its molecular formula is C9H11N1O2, indicating it contains nine carbon atoms, eleven hydrogen atoms, one nitrogen atom, and two oxygen atoms. This compound typically appears as a yellow to brown solid at room temperature and has a relatively high melting point. It is known for its moderate solubility in organic solvents, such as ethanol and acetone, while being less soluble in water. 2,6-Dimethylnitrobenzene is primarily used in organic synthesis and as an intermediate in the production of dyes, pharmaceuticals, and agrochemicals. It exhibits characteristic nitro group reactivity, making it a useful precursor for further chemical transformations. However, like many nitro compounds, it may pose environmental and health risks, necessitating careful handling and disposal.
Formula:C8H9NO2
InChI:InChI=1S/C8H9NO2/c1-6-4-3-5-7(2)8(6)9(10)11/h3-5H,1-2H3
InChI key:InChIKey=HDFQKJQEWGVKCQ-UHFFFAOYSA-N
SMILES:O=N(=O)C=1C(=CC=CC1C)C
- Synonyms:
- 1,3-Dimethyl-2-Nitrobenzene
- 2,6-Dimethyl-1-nitrobenzene
- 2,6-Dimethylnitrobenzene
- 2-Nitro-1,3-dimethylbenzene
- 2-Nitro-1,3-xylene
- Benzene, 1,3-dimethyl-2-nitro-
- NSC 9811
- m-Xylene, 2-nitro-
- 2-Nitro-m-xylene
