CAS 812-70-4: 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Pentadecafluorodecanoic acid
Description:4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Pentadecafluorodecanoic acid, commonly referred to as PFDA, is a perfluorinated carboxylic acid characterized by a long carbon chain fully substituted with fluorine atoms, except for the terminal carboxylic acid group. This structure imparts unique properties, such as high thermal stability, low surface tension, and resistance to degradation, making PFDA highly persistent in the environment. It is typically a solid at room temperature and exhibits low solubility in water due to its hydrophobic fluorinated tail, while being soluble in organic solvents. PFDA is known for its surfactant properties and has been used in various industrial applications, including coatings and textiles, to impart water and oil repellency. However, due to its environmental persistence and potential health concerns, PFDA is subject to regulatory scrutiny, and its use is being phased out in many regions. The substance is also a subject of ongoing research regarding its environmental impact and potential effects on human health.
Formula:C10H5F15O2
InChI:InChI=1S/C10H5F15O2/c11-4(12,2-1-3(26)27)5(13,14)6(15,16)7(17,18)8(19,20)9(21,22)10(23,24)25/h1-2H2,(H,26,27)
InChI key:InChIKey=HLBRGVKRZQSQHB-UHFFFAOYSA-N
SMILES:O=C(O)CCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F
- Synonyms:
- 2H,2H,3H,3H-Pentadecafluorodecanoic acid
- 2H,2H,3H,3H-Perfluorodecanoic acid
- 7:3 Ftca
- Decanoic Acid, 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Pentadecafluoro-
- 4,4,5,5,6,6,7,7,8,8,9,9,10,10,10-Pentadecafluorodecanoic acid
