CymitQuimica logo

CAS 835621-12-0

:

2-Pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-3-fluorophenoxy]-, 1-oxide

Description:
2-Pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-3-fluorophenoxy]-, 1-oxide, identified by CAS number 835621-12-0, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyridine ring, multiple aromatic systems, and various functional groups such as amides and halogens. This compound typically exhibits properties associated with its heterocyclic and aromatic nature, including potential solubility in polar solvents and moderate stability under standard conditions. The presence of chlorine and trifluoromethyl groups suggests that it may possess unique electronic properties, potentially influencing its reactivity and biological activity. Additionally, the compound's structure indicates that it may be of interest in pharmaceutical research, particularly in the development of targeted therapies or as a biochemical probe. Its specific interactions, such as binding affinity to biological targets, would require empirical investigation to fully understand its potential applications and safety profile.
Formula:C20H13ClF4N4O4
InChI:InChI=1S/C20H13ClF4N4O4/c21-14-3-1-10(7-13(14)20(23,24)25)27-19(31)28-16-4-2-11(8-15(16)22)33-12-5-6-29(32)17(9-12)18(26)30/h1-9H,(H2,26,30)(H2,27,28,31)
InChI key:InChIKey=JPEWXTSDCNCZOD-UHFFFAOYSA-N
SMILES:O(C=1C=C(C(N)=O)N(=O)=CC1)C2=CC(F)=C(NC(NC3=CC(C(F)(F)F)=C(Cl)C=C3)=O)C=C2
Synonyms:
  • 2-Pyridinecarboxamide, 4-[4-[[[[4-chloro-3-(trifluoromethyl)phenyl]amino]carbonyl]amino]-3-fluorophenoxy]-, 1-oxide
Found 15 products.