CAS 845932-30-1

KU59403

Description:

KU59403, with the CAS number 845932-30-1, is a small molecule that has garnered attention in the field of medicinal chemistry, particularly for its potential as a therapeutic agent. It is primarily recognized as a selective inhibitor of the protein kinase known as AKT, which plays a crucial role in various cellular processes, including metabolism, proliferation, and survival. The inhibition of AKT can have significant implications in cancer treatment, as aberrant AKT signaling is often associated with tumor growth and resistance to therapy. KU59403 exhibits a specific binding affinity for the AKT protein, which may lead to the modulation of downstream signaling pathways. In terms of its physical and chemical properties, KU59403 is characterized by its molecular structure, which includes specific functional groups that contribute to its biological activity. Research into KU59403 continues to explore its efficacy, safety, and potential applications in clinical settings, particularly in oncology.

Formula: C29H32N4O4S2

InChI: InChI=1S/C29H32N4O4S2/c1-31-9-11-32(12-10-31)8-7-27(35)30-20-5-6-24-26(17-20)38-25-4-2-3-22(29(25)39-24)23-18-21(34)19-28(37-23)33-13-15-36-16-14-33/h2-6,17-19H,7-16H2,1H3,(H,30,35)

InChI key: IIBZKDYAYJSSGB-UHFFFAOYSA-N

SMILES: CN1CCN(CC1)CCC(=O)NC2=CC3=C(C=C2)SC4=C(C=CC=C4S3)C5=CC(=O)C=C(O5)N6CCOCC6

3-(4-Methylpiperazin-1-yl)-N-(6-(6-morpholino-4-oxo-4H-pyran-2-yl)thianthren-2-yl)propanamide

CAS: 845932-30-1

3-(4-Methylpiperazin-1-yl)-N-(6-(6-morpholino-4-oxo-4H-pyran-2-yl)thianthren-2-yl)propanamide

Formula: C₂₉H₃₂N₄O₄S₂

Purity: 95+%

Molecular weight: 564.73

Ref: 54-OR1074648

KU 59403

CAS: 845932-30-1

Formula: C₂₉H₃₂N₄O₄S₂

Molecular weight: 564.7188

Ref: IN-DA00G8C9

KU 59403

CAS: 845932-30-1

3-(4-Methylpiperazin-1-yl)-N-(6-(6-morpholino-4-oxo-4H-pyran-2-yl)thianthren-2-yl)propanamide

Formula: C₂₉H₃₂N₄O₄S₂

Purity: 95+%

Molecular weight: 564.72

Ref: IN-DG287631

KU 59403

CAS: 845932-30-1

KU 59403 is a potent inhibitor that functions as an anti-proliferative agent, targeting specific biochemical pathways. Developed through chemical synthesis, it primarily acts as an inhibitor of DNA-dependent protein kinase (DNA-PK). This kinase is integral to the non-homologous end joining (NHEJ) pathway, responsible for repairing double-strand breaks in DNA.

Formula: C₂₉H₃₂N₄O₄S₂

Purity: Min. 95%

Molecular weight: 564.72 g/mol

Ref: 3D-VIB93230

KU 59403

CAS: 845932-30-1

KU 59403 is an effective ATM inhibitor (IC50: 3 nM, 9.1 μM, and 10 μM for ATM, DNA-PK, and PI3K, respectively).

Formula: C₂₉H₃₂N₄O₄S₂

Purity: 99.10% - 99.79%

Color and Shape: Solid

Molecular weight: 564.719

Ref: TM-T15673