CymitQuimica logo

CAS 852391-15-2

:

2,4-Imidazolidinedione, 5-[(7-chloro-1H-indol-3-yl)methyl]-3-methyl-

Description:
2,4-Imidazolidinedione, 5-[(7-chloro-1H-indol-3-yl)methyl]-3-methyl- is a synthetic organic compound characterized by its imidazolidinedione core, which features two carbonyl groups adjacent to a nitrogen atom. This compound exhibits a complex structure due to the presence of a chloro-substituted indole moiety, contributing to its potential biological activity. The imidazolidinedione framework is known for its role in various pharmacological applications, including as a scaffold for drug development. The presence of the indole group may enhance its interaction with biological targets, potentially influencing its pharmacokinetics and pharmacodynamics. The compound is likely to be soluble in organic solvents, and its stability may be influenced by environmental factors such as pH and temperature. As with many synthetic compounds, safety and handling precautions should be observed, particularly due to the presence of chlorine, which can impart toxicity. Overall, this compound represents a class of molecules that may have significant implications in medicinal chemistry and drug discovery.
Formula:C13H12ClN3O2
InChI:InChI=1S/C13H12ClN3O2/c1-17-12(18)10(16-13(17)19)5-7-6-15-11-8(7)3-2-4-9(11)14/h2-4,6,10,15H,5H2,1H3,(H,16,19)
InChI key:WIKGAEMMNQTUGL-UHFFFAOYSA-N
SMILES:CN1C(=O)C(NC1=O)CC2=CNC3=C2C=CC=C3Cl
Synonyms:
  • 5-((7-Cl-1H-indol-3-yl)Methyl)-3-MethyliMidazolidine-2,4-dione)
Found 7 products.