CymitQuimica logo

CAS 87924-01-4

:

Benzene, diethenyl-, polymer with ethenylbenzene, brominated

Description:
Benzene, diethenyl-, polymer with ethenylbenzene, brominated, identified by CAS number 87924-01-4, is a synthetic polymer characterized by its structure, which includes brominated units derived from benzene and vinyl groups. This polymer exhibits properties typical of aromatic compounds, such as thermal stability and resistance to chemical degradation. The bromination enhances its flame-retardant properties, making it suitable for applications requiring reduced flammability. Additionally, the presence of vinyl groups contributes to its ability to undergo further polymerization or cross-linking, which can modify its mechanical properties and enhance its utility in various industrial applications. The polymer is often utilized in coatings, adhesives, and composite materials due to its durability and resistance to environmental factors. Safety considerations are important when handling this substance, as brominated compounds can pose health risks, necessitating appropriate precautions during use and disposal. Overall, this polymer represents a versatile material with specific characteristics tailored for specialized applications in the chemical industry.
Formula:(C10H10·C8H8)x
InChI:InChI=1/C10H10.C8H8/c1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8/h3-8H,1-2H2;2-7H,1H2
SMILES:C=Cc1ccccc1C=C.C=Cc1ccccc1
Synonyms:
  • Benzene, diethenyl-, polymer with ethenylbenzene, brominated
Found 2 products.