CAS 88095-77-6
:Dieckol
Description:
Dieckol is a naturally occurring phenolic compound primarily derived from brown algae, particularly from the genus Ecklonia. It is known for its distinctive structure, which includes multiple phenolic hydroxyl groups that contribute to its antioxidant properties. Dieckol exhibits a range of biological activities, including anti-inflammatory, antimicrobial, and anticancer effects, making it a subject of interest in pharmacological research. Its antioxidant capacity is attributed to its ability to scavenge free radicals and inhibit oxidative stress, which is linked to various chronic diseases. Additionally, dieckol has been studied for its potential in enhancing skin health and protecting against UV radiation. The compound is soluble in organic solvents and has a relatively low molecular weight, which facilitates its absorption and bioavailability in biological systems. Overall, dieckol represents a promising natural product with potential applications in health and wellness, although further research is needed to fully understand its mechanisms of action and therapeutic potential.
Formula:C36H22O18
InChI:InChI=1S/C36H22O18/c37-12-1-13(38)3-15(2-12)49-31-22(44)10-25(47)34-35(31)54-30-21(43)8-17(9-27(30)52-34)48-28-19(41)6-16(7-20(28)42)50-32-23(45)11-24(46)33-36(32)53-29-18(40)4-14(39)5-26(29)51-33/h1-11,37-47H
InChI key:InChIKey=DRZQFGYIIYNNEC-UHFFFAOYSA-N
SMILES:O(C1=C2C(OC=3C(O2)=C(O)C=C(OC4=C(O)C=C(OC5=C6C(OC=7C(O6)=C(O)C=C(O)C7)=C(O)C=C5O)C=C4O)C3)=C(O)C=C1O)C8=CC(O)=CC(O)=C8
Synonyms:- 4-[4-[[6-(3,5-Dihydroxyphenoxy)-4,7,9-trihydroxydibenzo[b,e][1,4]dioxin-2-yl]oxy]-3,5-dihydroxyphenoxy]dibenzo[b,e][1,4]dioxin-1,3,6,8-tetrol
- Dibenzo[b,e][1,4]dioxin-1,3,6,8-tetrol, 4-[4-[[6-(3,5-dihydroxyphenoxy)-4,7,9-trihydroxydibenzo[b,e][1,4]dioxin-2-yl]oxy]-3,5-dihydroxyphenoxy]-
- 8,4′′′-Dieckol
- Dieckol
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 6 products.
4-(4-((6-(3,5-Dihydroxyphenoxy)-4,7,9-trihydroxydibenzo[b,e][1,4]dioxin-2-yl)oxy)-3,5-dihydroxyphenoxy)dibenzo[b,e][1,4]dioxine-1,3,6,8-tetraol
CAS:4-(4-((6-(3,5-Dihydroxyphenoxy)-4,7,9-trihydroxydibenzo[b,e][1,4]dioxin-2-yl)oxy)-3,5-dihydroxyphenoxy)dibenzo[b,e][1,4]dioxine-1,3,6,8-tetraolFormula:C36H22O18Purity:98%Molecular weight:742.55Dieckol
CAS:Dieckol is a rhizomycin found in some brown algae species with antimicrobial, anticancer, antioxidant, anti-aging, antidiabetic, and neuroprotective properties.Formula:C36H22O18Purity:98.33%Color and Shape:SolidMolecular weight:742.55Ref: IN-DA01EEWY
1gTo inquire10mgTo inquire25mgTo inquire100mgTo inquire250mgTo inquire500mgTo inquire1mg168.00€2mg673.00€5mg676.00€Dieckol
CAS:4-(4-((6-(3,5-Dihydroxyphenoxy)-4,7,9-trihydroxydibenzo[b,e][1,4]dioxin-2-yl)oxy)-3,5-dihydroxyphenoxy)dibenzo[b,e][1,4]dioxine-1,3,6,8-tetraolFormula:C36H22O18Purity:98%Molecular weight:742.55Dieckol
CAS:Oxygen-heterocyclic compoundFormula:C36H22O18Purity:≥ 90.0 % (HPLC)Color and Shape:PowderMolecular weight:742.55Dieckol
CAS:Dieckol is a polyphenolic compound, which is a type of marine-derived phlorotannin. It is extracted predominantly from brown algae, such as species belonging to the genus Ecklonia. Dieckol exhibits its mode of action primarily through its antioxidant properties, attributed to its ability to scavenge free radicals and inhibit oxidative stress pathways. Additionally, it demonstrates anti-inflammatory and anti-cancer activities by modulating various cellular signaling pathways.Formula:C36H22O18Purity:Min. 95%Color and Shape:PowderMolecular weight:742.55 g/mol





