CAS 90-18-6: Quercetagetin
Description:Quercetagetin is a flavonoid, a type of polyphenolic compound, known for its various biological activities and potential health benefits. It is characterized by its yellow crystalline appearance and is soluble in organic solvents like ethanol and methanol, but less soluble in water. Quercetagetin exhibits antioxidant properties, which help in neutralizing free radicals, thereby contributing to its potential protective effects against oxidative stress-related diseases. Additionally, it has been studied for its anti-inflammatory, anticancer, and antimicrobial activities. The compound is found in various plants, particularly in the leaves and flowers of certain species, and is often associated with traditional medicinal uses. Its structure features a flavone backbone, which is common among flavonoids, and it can undergo various chemical modifications, influencing its biological activity. Quercetagetin's potential therapeutic applications continue to be explored in scientific research, highlighting its significance in both nutrition and pharmacology.
Formula:C15H10O8
InChI:InChI=1S/C15H10O8/c16-6-2-1-5(3-7(6)17)15-14(22)13(21)10-9(23-15)4-8(18)11(19)12(10)20/h1-4,16-20,22H
InChI key:InChIKey=ZVOLCUVKHLEPEV-UHFFFAOYSA-N
SMILES:O=C1C(O)=C(OC2=CC(O)=C(O)C(O)=C12)C=3C=CC(O)=C(O)C3
- Synonyms:
- 2-(3,4-Dihydroxyphenyl)-3,5,6,7-tetrahydroxy-4H-1-benzopyran-4-one
- 2-(3,4-dihydroxyphenyl)-3,5,6,7-tetrahydroxy-4H-chromen-4-one
- 3,3',4',5,6,7-Hexahydroxyflavone
- 3,3′,4′,5,6,7-Hexahydroxyflavone
- 3,5,6,7,3',4'-Hexahydroxyflavone
- 3,5,6,7,3′,4′-Hexahydroxyflavone
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,6,7-tetrahydroxy-
- 4H-1-Benzopyran-4-one, 2-(3,4-dihydroxyphenyl)-3,5,6,7-tetrahydroxy- (9CI)
- 6-Hydroxyquercetin
- Flavone, 3,3',4',5,6,7-hexahydroxy- (8CI)
- See more synonyms
- Flavone, 3,3′,4′,5,6,7-hexahydroxy-
- Nsc 115916
- Quercetagetin
- 2-(3,4-Dihydroxyphenyl)-3,5,6,7-tetrahydroxy-4-benzopyrone
