CymitQuimica logo

CAS 911-60-4

:

Isoquinoline, 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-3,4-dihydro-, hydrochloride (1:1)

Description:
Isoquinoline, 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-3,4-dihydro-, hydrochloride (1:1), with CAS number 911-60-4, is a chemical compound that belongs to the isoquinoline class of alkaloids. This substance features a bicyclic structure characterized by a fused benzene and pyridine ring, which contributes to its unique chemical properties. The presence of multiple ethoxy groups enhances its solubility and reactivity, making it of interest in various chemical applications. As a hydrochloride salt, it is typically more stable and soluble in water compared to its free base form. Isoquinoline derivatives are known for their biological activities, including potential pharmacological effects, which may include analgesic, anti-inflammatory, or antimicrobial properties. The compound's specific characteristics, such as melting point, boiling point, and spectral data, would be essential for practical applications and further research. Safety data should also be considered, as with any chemical substance, to ensure proper handling and usage in laboratory or industrial settings.
Formula:C24H31NO4·ClH
InChI:InChI=1S/C24H31NO4.ClH/c1-5-26-21-10-9-17(14-22(21)27-6-2)13-20-19-16-24(29-8-4)23(28-7-3)15-18(19)11-12-25-20;/h9-10,14-16H,5-8,11-13H2,1-4H3;1H
InChI key:InChIKey=STBFLOYKRMKBRN-UHFFFAOYSA-N
SMILES:C(C=1C=2C(=CC(OCC)=C(OCC)C2)CCN1)C3=CC(OCC)=C(OCC)C=C3.Cl
Synonyms:
  • Isoquinoline, 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-3,4-dihydro-, hydrochloride
  • Isoquinoline, 1-[(3,4-diethoxyphenyl)methyl]-6,7-diethoxy-3,4-dihydro-, hydrochloride (1:1)
  • Isoquinoline, 1-(3,4-diethoxybenzyl)-6,7-diethoxy-3,4-dihydro-, hydrochloride
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.