CAS 95262-48-9
:Urs-12-en-28-oic acid,2,3,19,23-tetrahydroxy-, b-D-glucopyranosyl ester, (2a,3b,4a)-
Description:
Urs-12-en-28-oic acid, 2,3,19,23-tetrahydroxy-, b-D-glucopyranosyl ester, with the CAS number 95262-48-9, is a complex organic compound characterized by its triterpenoid structure, which is derived from ursolic acid. This substance features multiple hydroxyl groups, contributing to its hydrophilicity and potential biological activity. The presence of a glucopyranosyl ester indicates that it is a glycoside, which may enhance its solubility in water and influence its pharmacological properties. The specific stereochemistry, denoted by the (2a,3b,4a) configuration, suggests a particular three-dimensional arrangement that can affect the compound's interactions with biological targets. Such compounds are often studied for their potential health benefits, including anti-inflammatory, antioxidant, and anticancer properties. The structural complexity and functional groups present in this molecule make it a subject of interest in medicinal chemistry and natural product research. Further studies are necessary to fully elucidate its biological activities and potential applications in therapeutics.
Formula:C36H58O11
InChI:InChI=1S/C36H58O11/c1-18-9-12-36(30(44)47-29-26(42)25(41)24(40)21(16-37)46-29)14-13-33(4)19(27(36)35(18,6)45)7-8-23-31(2)15-20(39)28(43)32(3,17-38)22(31)10-11-34(23,33)5/h7,18,20-29,37-43,45H,8-17H2,1-6H3/t18-,20-,21-,22-,23-,24-,25+,26-,27-,28+,29+,31+,32+,33-,34-,35-,36+/m1/s1
InChI key:InChIKey=WKKBYJLXSKPKSC-JVJIQXRHSA-N
SMILES:C(O[C@@H]1O[C@H](CO)[C@@H](O)[C@H](O)[C@H]1O)(=O)[C@]23[C@](C=4[C@@](C)(CC2)[C@@]5(C)[C@](CC4)([C@]6(C)[C@@](CC5)([C@@](CO)(C)[C@@H](O)[C@H](O)C6)[H])[H])([C@](C)(O)[C@H](C)CC3)[H]
Synonyms:- 19α-Hydroxyasiatic acid 28-O-β-<span class="text-smallcaps">D</span>-glucopyranoside
- 19α-Hydroxyasiatic acid β-<span class="text-smallcaps">D</span>-glucopyranosyl ester
- Dotorioside II
- DotoriosideII
- Laevigatanoside A
- Niga-ichigoside F 1
- Urs-12-en-28-oic acid, 2,3,19,23-tetrahydroxy-, β-<span class="text-smallcaps">D</span>-glucopyranosyl ester, (2α,3β,4α)-
- 19α-Hydroxyasiatic acid 28-O-β-D-glucopyranoside
- Urs-12-en-28-oic acid, 2,3,19,23-tetrahydroxy-, β-D-glucopyranosyl ester, (2α,3β,4α)-
- niga-ichigoside F1
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 4 products.
Urs-12-en-28-oic acid, 2,3,19,23-tetrahydroxy-, β-D-glucopyranosyl ester, (2α,3β,4α)-
CAS:Formula:C36H58O11Purity:95%Molecular weight:666.8391Niga-ichigoside F1
CAS:Niga-ichigoside F1 is a natural product that activates Nrf2 and improves high-fat diet-induced hepatic steatosis ,inhibiting the NF-κB pathway.Formula:C36H58O11Purity:99.97%Color and Shape:White SolidMolecular weight:666.85Niga-ichigoside F1
CAS:Niga-ichigoside F1 is a triterpenoid saponin, which is an organic compound primarily sourced from the leaves and roots of certain plants, notably those in the Rosaceae family. It acts through various biochemical pathways, including the inhibition of tumor cell proliferation and induction of apoptosis in cancer cells. The mechanism involves modulation of specific signaling pathways and disruption of cellular homeostasis, which can lead to cell cycle arrest and subsequent cell death.Formula:C36H58O11Purity:Min. 95%Molecular weight:666.8 g/mol




