CAS 1000025-07-9: N-[[5-(3-Chlorophenyl)-3-hydroxy-2-pyridinyl]carbonyl]glycine
Description:N-[[5-(3-Chlorophenyl)-3-hydroxy-2-pyridinyl]carbonyl]glycine, identified by its CAS number 1000025-07-9, is a chemical compound characterized by its complex structure, which includes a pyridine ring, a chlorophenyl group, and a glycine moiety. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the hydroxyl group on the pyridine ring may enhance its solubility in polar solvents and influence its interaction with biological targets. Additionally, the chlorophenyl substituent can impart specific electronic properties, potentially affecting the compound's reactivity and binding affinity in biochemical contexts. Such characteristics suggest that this compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting specific pathways or receptors. However, detailed studies on its pharmacokinetics, toxicity, and efficacy would be necessary to fully understand its potential uses and safety profile.
Formula:C14H11ClN2O4
InChI:InChI=1S/C14H11ClN2O4/c15-10-3-1-2-8(4-10)9-5-11(18)13(16-6-9)14(21)17-7-12(19)20/h1-6,18H,7H2,(H,17,21)(H,19,20)
InChI key:InChIKey=JGRXMPYUTJLTKT-UHFFFAOYSA-N
SMILES:O=C(O)CNC(=O)C=1N=CC(=CC1O)C2=CC=CC(Cl)=C2
- Synonyms:
- AKB 6548
- Glycine, N-[[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]carbonyl]-
- PG 1016548
- Vadadustat
- N-[[5-(3-Chlorophenyl)-3-hydroxy-2-pyridinyl]carbonyl]glycine
![N-[[5-(3-Chlorophenyl)-3-hydroxy-2-pyridinyl]carbonyl]glycine](https://static.cymitquimica.com/cas-image/405016-n-5-3-chlorophenyl-3-hydroxy-2-pyridinyl-carbonyl-glycine.png)
![Glycine, N-[[5-(3-chlorophenyl)-3-hydroxy-2-pyridinyl]carbonyl]-](https://static.cymitquimica.com/products/IN/thumb/DA00008T.jpg)
