CAS 118-96-7
:2,4,6-Trinitrotoluene
Description:
2,4,6-Trinitrotoluene, commonly known as TNT, is an organic compound with the molecular formula C7H5N3O6. It is characterized by its yellow crystalline appearance and is primarily known for its use as an explosive material. TNT is relatively stable under normal conditions, which makes it safer to handle compared to other explosives. Its structure features a toluene ring with three nitro groups (-NO2) attached at the 2, 4, and 6 positions, contributing to its explosive properties. TNT has a melting point of around 80 degrees Celsius and a boiling point of approximately 240 degrees Celsius. It is insoluble in water but soluble in organic solvents such as acetone and ether. The compound is also known for its ability to undergo detonation, producing a significant amount of gas and heat, which is harnessed in military and industrial applications. Additionally, TNT is subject to environmental concerns due to its persistence and potential toxicity, leading to ongoing research into its degradation and remediation.
Formula:C7H5N3O6
InChI:InChI=1S/C7H5N3O6/c1-4-6(9(13)14)2-5(8(11)12)3-7(4)10(15)16/h2-3H,1H3
InChI key:InChIKey=SPSSULHKWOKEEL-UHFFFAOYSA-N
SMILES:N(=O)(=O)C1=C(C)C(N(=O)=O)=CC(N(=O)=O)=C1
Synonyms:- 1,2,3-Trinitrobenzene
- 1-Methyl-2,3,4-Trinitrobenzene
- 1-Methyl-2,4,6-Trinitrobenzene
- 2,4,6-Trinitrotolueno
- 2,4,6-Trinitrotoluol
- 2-Methyl-1,3,5-Trinitrobenzene
- 4-Methyl-1,3,5-trinitrobenzene
- Alpha-Trinitrotoluol
- Benzene, 2-methyl-1,3,5-trinitro-
- Gradetol
- Methyltrinitrobenzene
- Nsc 36949
- S-Trinitrotoluene
- S-Trinitrotoluol
- Sym-Trinitrotoluene
- Sym-Trinitrotoluol
- TNT
- Tolit
- Tolite
- Toluene, 2,4,6-trinitro-
- Toluene, Trinitro-
- Trilit
- Trinitrotoluene
- Trinitrotoluene, 2,4,6-? trinitrotoluol
- Tritol
- Tritol (explosive)
- Trotyl
- Trotyl oil
- Un3366
- See more synonyms
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 10 products.
Explosives Nitrobenzenes and -toluenes Mixture 643 100 µg/mL in Methanol
CAS:Controlled ProductColor and Shape:Mixture2,4,6-Trinitrotoluene (TNT) 1000 µg/mL in Acetonitrile:Methanol
CAS:Controlled ProductFormula:C7H5N3O6Color and Shape:ColourlessMolecular weight:227.132,4,6-Trinitrotoluene (TNT) 100 µg/mL in Cyclohexane
CAS:Controlled ProductFormula:C7H5N3O6Color and Shape:Single SolutionMolecular weight:227.13

