CAS 162650-77-3: Ethaboxam
Description:Ethaboxam, with the CAS number 162650-77-3, is a chemical compound primarily recognized for its application as a fungicide in agricultural practices. It belongs to the class of compounds known as benzamide derivatives and is characterized by its ability to inhibit specific fungal pathogens, thereby protecting crops from diseases. Ethaboxam exhibits systemic properties, allowing it to be absorbed and translocated within plants, which enhances its efficacy against a range of fungal infections. The compound is typically applied to various crops, including vegetables and cereals, and is valued for its relatively low toxicity to non-target organisms, making it a more environmentally friendly option compared to some traditional fungicides. Its mode of action involves disrupting fungal cell function, which ultimately leads to the inhibition of growth and reproduction of the pathogens. As with any chemical substance, proper handling and adherence to safety guidelines are essential to mitigate any potential risks associated with its use.
Formula:C14H16N4OS2
InChI:InChI=1S/C14H16N4OS2/c1-3-9-12(21-14(18-9)16-4-2)13(19)17-10(8-15)11-6-5-7-20-11/h5-7,10H,3-4H2,1-2H3,(H,16,18)(H,17,19)
InChI key:InChIKey=NQRFDNJEBWAUBL-UHFFFAOYSA-N
SMILES:N#CC(NC(=O)C=1SC(=NC1CC)NCC)C=2SC=CC2
- Synonyms:
- 162650-77-3
- 5-Thiazolecarboxamide, N-(cyano-2-thienylmethyl)-4-ethyl-2-(ethylamino)-
- Ethaboxam
- Ethofin
- Guardian
- Intego Solo
- N-(Cyano-2-thienylmethyl)-4-ethyl-2-(ethylamino)-5-thiazolecarboxamide

LC PestiMix 7 10 µg/mL in Acetonitrile
Ref: 04-A50000807AL
1ml | To inquire |

Ethaboxam
Controlled ProductRef: 04-C13217000
50mg | To inquire |

PestiMix 4 5 μg/mL in Acetonitrile:Acetone (72:13.5)
Controlled ProductRef: 04-A50000085AA
1ml | 1,287.00 € |

Ethaboxam
Controlled ProductRef: TR-E675700
5mg | 97.00 € | ||
50mg | 291.00 € |

Ethaboxam-d5
Controlled ProductRef: TR-E675702
1mg | 304.00 € | ||
10mg | 1,964.00 € |