CAS 1718-52-1: Pyrene-d10
Description:Pyrene-d10 is a deuterated form of pyrene, a polycyclic aromatic hydrocarbon (PAH) known for its distinct fluorescence properties. The "d10" designation indicates that ten hydrogen atoms in the pyrene molecule have been replaced with deuterium, a stable isotope of hydrogen. This substitution alters the physical and chemical properties of the compound, making it useful in various applications, particularly in research and analytical chemistry. Pyrene-d10 retains the characteristic structure of pyrene, which consists of four fused benzene rings, contributing to its stability and hydrophobic nature. The deuteration enhances its utility in nuclear magnetic resonance (NMR) spectroscopy, allowing for more precise studies of molecular dynamics and interactions. Additionally, due to its fluorescence, pyrene-d10 is often employed as a probe in studies of solvent effects and in the investigation of molecular aggregation. Its CAS number, 1718-52-1, uniquely identifies this compound in chemical databases, facilitating its recognition and use in scientific literature.
Formula:C16D10
InChI:InChI=1S/C16H10/c1-3-11-7-9-13-5-2-6-14-10-8-12(4-1)15(11)16(13)14/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D
InChI key:InChIKey=BBEAQIROQSPTKN-LHNTUAQVSA-N
SMILES:C=1C=C2C=CC3=CC=CC=4C=CC(C1)=C2C34
- Synonyms:
- Perdeuteriopyrene
- Pyrene-1,2,3,4,5,6,7,8,9,10-d10
- [10-2H]Pyrene
- Pyrene-d10
- [2H10]Pyrene
