CymitQuimica logo

CAS 93952-01-3

:

Benzo[k]fluoranthene-1,2,3,4,5,6,7,8,9,10,11,12-d12

Description:
Benzo[k]fluoranthene-1,2,3,4,5,6,7,8,9,10,11,12-d12 is a polycyclic aromatic hydrocarbon (PAH) that is a deuterated form of benzo[k]fluoranthene, which is known for its complex structure consisting of multiple fused aromatic rings. The presence of deuterium, a stable isotope of hydrogen, in this compound allows for specific applications in research, particularly in studies involving isotopic labeling and tracing. This compound is typically used in environmental chemistry and toxicology to investigate the behavior and effects of PAHs, which are known to be environmental pollutants and potential carcinogens. Benzo[k]fluoranthene itself is characterized by its high stability and hydrophobic nature, leading to its persistence in the environment. The deuterated version may exhibit slightly altered physical and chemical properties compared to its non-deuterated counterpart, such as changes in boiling and melting points, which can be useful in analytical techniques like mass spectrometry. Overall, this compound serves as a valuable tool in scientific research, particularly in understanding the fate and transport of PAHs in various environments.
Formula:C20D12
InChI:InChI=1S/C20H12/c1-2-6-15-12-19-17-10-4-8-13-7-3-9-16(20(13)17)18(19)11-14(15)5-1/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D
InChI key:HAXBIWFMXWRORI-AQZSQYOVSA-N
SMILES:[2H]C1=C(C(=C2C(=C3C4=C(C(=C(C5=C4C(=C(C(=C5[2H])[2H])[2H])C3=C(C2=C1[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]
Synonyms:
  • Benzo[k]fluoranthene-d12(9CI)
Found 6 products.