CymitQuimica logo

CAS 1718-53-2

:

1,2-benzanthracene-D12

Description:
1,2-Benzanthracene-D12, with the CAS number 1718-53-2, is a deuterated polycyclic aromatic hydrocarbon (PAH) that serves as a labeled compound in various chemical and biological studies. Its structure consists of a fused ring system, specifically featuring four fused benzene rings, which contributes to its stability and hydrophobic nature. The "D12" designation indicates that twelve hydrogen atoms in the molecule have been replaced with deuterium, a stable isotope of hydrogen, enhancing its utility in tracing and analytical applications, particularly in mass spectrometry and NMR spectroscopy. This compound is of interest in environmental chemistry due to its potential role as a pollutant and its implications in studies related to carcinogenicity, as many PAHs are known to be toxic and mutagenic. Additionally, the presence of deuterium allows for more precise tracking of the compound's behavior in various chemical reactions and biological systems, making it a valuable tool in research focused on the environmental fate of PAHs and their biological effects.
Formula:C18H12
InChI:InChI=1S/C18H12/c1-2-7-15-12-18-16(11-14(15)6-1)10-9-13-5-3-4-8-17(13)18/h1-12H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D,11D,12D
InChI key:DXBHBZVCASKNBY-AQZSQYOVSA-N
SMILES:[2H]C1=C(C(=C2C(=C1[2H])C(=C(C3=C(C4=C(C(=C(C(=C4C(=C32)[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H])[2H]
Found 12 products.