CAS 81103-79-9: Fluorene-d10
Description:Fluorene-d10, with the CAS number 81103-79-9, is a deuterated form of fluorene, a polycyclic aromatic hydrocarbon. It consists of a fused ring system comprising two benzene rings and a cyclopentane ring. The "d10" designation indicates that ten hydrogen atoms in the fluorene structure have been replaced with deuterium, a stable isotope of hydrogen. This substitution alters the physical and chemical properties of the compound, such as its mass and vibrational characteristics, making it useful in various applications, particularly in NMR spectroscopy and studies involving isotopic labeling. Fluorene-d10 retains the aromatic properties of its non-deuterated counterpart, exhibiting stability and relatively low reactivity under standard conditions. It is typically used in research settings, including organic synthesis and material science, due to its unique isotopic composition, which can provide insights into reaction mechanisms and molecular dynamics. As with many organic compounds, proper handling and storage are essential to ensure safety and maintain the integrity of the substance.
Formula:C13D10
InChI:InChI=1/C13H10/c1-3-7-12-10(5-1)9-11-6-2-4-8-13(11)12/h1-8H,9H2/i1D,2D,3D,4D,5D,6D,7D,8D,9D2
- Synonyms:
- 9H-Fluorene-1,2,3,4,5,6,7,8,9,9-d10
- (~2~H_10_)-9H-fluorene
