CAS 1719-06-8: Anthracene-d10
Description:Anthracene-d10 is a deuterated form of anthracene, a polycyclic aromatic hydrocarbon (PAH) consisting of three fused benzene rings. The "d10" designation indicates that ten hydrogen atoms in the anthracene molecule have been replaced with deuterium, a stable isotope of hydrogen. This substitution alters the physical and chemical properties of the compound, making it useful in various applications, particularly in research and analytical chemistry. Anthracene-d10 retains the characteristic properties of anthracene, such as its solid-state at room temperature, high melting point, and ability to fluoresce under ultraviolet light. Its deuterated nature enhances its utility in nuclear magnetic resonance (NMR) spectroscopy, allowing for clearer spectral analysis due to reduced background signals from hydrogen. Additionally, it serves as a tracer in studies involving organic reactions and environmental monitoring. As with other PAHs, anthracene-d10 is hydrophobic and can be involved in various chemical reactions, including oxidation and electrophilic substitution. Safety precautions should be taken when handling this compound, as PAHs can pose health risks.
Formula:C14D10
InChI:InChI=1S/C14H10/c1-2-6-12-10-14-8-4-3-7-13(14)9-11(12)5-1/h1-10H/i1D,2D,3D,4D,5D,6D,7D,8D,9D,10D
InChI key:InChIKey=MWPLVEDNUUSJAV-LHNTUAQVSA-N
SMILES:C=1C=CC=2C=C3C=CC=CC3=CC2C1
- Synonyms:
- (2H10)Anthracene
- (~2~H_10_)anthracene
- 1,2,3,4,5,6,7,8,9,10-Decadeuterioanthracene
- Anthracene-1,2,3,4,5,6,7,8,9,10-d<sub>10</sub>
- Anthracene-d<sub>10</sub>
- Perdeuterated anthracene
- Perdeuterioanthracene
- Perdeuteroanthracene
- Anthracene-d10
- Anthracene-1,2,3,4,5,6,7,8,9,10-d10
- See more synonyms
