CAS 183552-38-7: Abarelix
Description:Abarelix is a synthetic peptide and a gonadotropin-releasing hormone (GnRH) antagonist, primarily used in the treatment of prostate cancer. Its mechanism of action involves the inhibition of GnRH receptors in the pituitary gland, leading to a decrease in the secretion of luteinizing hormone (LH) and follicle-stimulating hormone (FSH). This results in a reduction of testosterone production from the testes, which is crucial for the growth of prostate cancer cells. Abarelix is characterized by its ability to provide rapid suppression of testosterone levels without the initial surge associated with GnRH agonists. It is administered via subcutaneous injection and is known for its relatively short half-life, necessitating careful dosing. Common side effects may include injection site reactions, hot flashes, and changes in libido. As a peptide, its structure consists of a specific sequence of amino acids, contributing to its biological activity and specificity for the GnRH receptor. Overall, Abarelix represents a targeted therapeutic approach in managing hormone-sensitive malignancies.
Formula:C72H95ClN14O14
InChI:InChI=1/C72H95ClN14O14/c1-41(2)32-54(64(93)80-53(17-10-11-30-77-42(3)4)72(101)87-31-13-18-60(87)69(98)78-43(5)63(75)92)81-68(97)58(38-62(74)91)84-70(99)61(37-46-22-27-52(90)28-23-46)86(7)71(100)59(40-88)85-67(96)57(36-48-14-12-29-76-39-48)83-66(95)56(34-45-20-25-51(73)26-21-45)82-65(94)55(79-44(6)89)35-47-19-24-49-15-8-9-16-50(49)33-47/h8-9,12,14-16,19-29,33,39,41-43,53-61,77,88,90H,10-11,13,17-18,30-32,34-38,40H2,1-7H3,(H2,74,91)(H2,75,92)(H,78,98)(H,79,89)(H,80,93)(H,81,97)(H,82,94)(H,83,95)(H,84,99)(H,85,96)/t43-,53+,54+,55-,56-,57-,58-,59+,60+,61+/m1/s1
- Synonyms:
- Ppi-149
- Abarelix Acetate