CAS 208465-21-8: Mesosulfuron-methyl
Description:Mesosulfuron-methyl is a selective herbicide belonging to the sulfonylurea class, primarily used for controlling annual and perennial grasses and certain broadleaf weeds in various crops. Its chemical structure features a sulfonylurea moiety, which is responsible for its herbicidal activity by inhibiting the enzyme acetolactate synthase (ALS), crucial for amino acid synthesis in plants. This compound is typically applied post-emergence, allowing it to target actively growing weeds while minimizing harm to the crops. Mesosulfuron-methyl is characterized by its relatively low toxicity to mammals and birds, making it a preferred choice in integrated pest management systems. It is soluble in organic solvents and exhibits moderate stability under environmental conditions, although its persistence can vary based on soil type and climatic factors. Proper application techniques and adherence to recommended dosages are essential to maximize efficacy and minimize environmental impact. As with all agrochemicals, safety precautions should be observed to protect non-target organisms and ecosystems.
Formula:C17H21N5O9S2
InChI:InChI=1S/C17H21N5O9S2/c1-29-13-8-14(30-2)20-16(19-13)21-17(24)22-33(27,28)12-7-10(9-18-32(4,25)26)5-6-11(12)15(23)31-3/h5-8,18H,9H2,1-4H3,(H2,19,20,21,22,24)
InChI key:InChIKey=NIFKBBMCXCMCAO-UHFFFAOYSA-N
SMILES:O=C(OC)C1=CC=C(C=C1S(=O)(=O)NC(=O)NC=2N=C(OC)C=C(N2)OC)CNS(=O)(=O)C
- Synonyms:
- Ae-F 130060
- Ae-F 130060-00
- Benzoic acid, 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-4-[[(methylsulfonyl)amino]methyl]-, methyl ester
- Mesomaxx
- Methyl 2-[3-(4,6-dimethyoxypyrimidin-2-yl)ureidosulfonyl]-4-methanesulfonamidomethybenzoate
- Methyl 2-{[(4,6-Dimethoxypyrimidin-2-Yl)Carbamoyl]Sulfamoyl}-4-{[(Methylsulfonyl)Amino]Methyl}Benzoate
- Shima
- Mesosulfuron-methyl
![Benzoic acid, 2-[[[[(4,6-dimethoxy-2-pyrimidinyl)amino]carbonyl]amino]sulfonyl]-4-[[(methylsulfony…](https://static.cymitquimica.com/products/IN/thumb/DA002JPN.jpg)
