CymitQuimica logo

CAS 23576-24-1

:

5-amino-4-chloro-2-[4-(trifluoromethyl)phenyl]pyridazin-3(2H)-one

Description:
5-amino-4-chloro-2-[4-(trifluoromethyl)phenyl]pyridazin-3(2H)-one is a chemical compound characterized by its pyridazine core, which is a six-membered aromatic ring containing two nitrogen atoms. This compound features an amino group (-NH2) and a chloro group (-Cl) at specific positions on the pyridazine ring, contributing to its reactivity and potential biological activity. The presence of a trifluoromethyl group (-CF3) attached to a phenyl ring enhances its lipophilicity and may influence its pharmacokinetic properties. The trifluoromethyl group is known for its electron-withdrawing effects, which can affect the compound's overall stability and reactivity. This substance may exhibit various biological activities, making it of interest in medicinal chemistry and drug development. Its unique structural features suggest potential applications in pharmaceuticals, particularly in the development of compounds targeting specific biological pathways. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H7ClF3N3O
InChI:InChI=1/C11H7ClF3N3O/c12-9-8(16)5-17-18(10(9)19)7-3-1-6(2-4-7)11(13,14)15/h1-5H,16H2
SMILES:c1cc(ccc1C(F)(F)F)n1c(=O)c(c(cn1)N)Cl
Synonyms:
  • Norflurazon-Desmethyl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 5 products.