CAS 30125-64-5: N-(butan-2-yl)-6-methoxy-1,3,5-triazine-2,4-diamine
Description:N-(butan-2-yl)-6-methoxy-1,3,5-triazine-2,4-diamine, with the CAS number 30125-64-5, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This compound features a butan-2-yl substituent, which contributes to its hydrophobic properties, and a methoxy group that can influence its reactivity and solubility. The presence of amino groups in the triazine structure suggests potential for hydrogen bonding and reactivity in various chemical environments. Typically, triazines are known for their applications in agriculture as herbicides and in the synthesis of other organic compounds. The specific characteristics of this compound, such as its melting point, boiling point, solubility, and stability, would depend on its molecular structure and the interactions of its functional groups. Additionally, its biological activity and potential applications would be influenced by its chemical properties, making it of interest in both industrial and research contexts.
Formula:C8H15N5O
InChI:InChI=1/C8H15N5O/c1-4-5(2)10-7-11-6(9)12-8(13-7)14-3/h5H,4H2,1-3H3,(H3,9,10,11,12,13)
