CAS 354-88-1
:pentafluoroethanesulfonic acid
Description:
Pentafluoroethanesulfonic acid, also known as perfluoroethanesulfonic acid, is a highly fluorinated organic compound characterized by its strong acidity and unique chemical properties. It features a sulfonic acid functional group (-SO3H) attached to a perfluorinated ethane backbone, which contributes to its stability and resistance to chemical degradation. This compound is typically a colorless liquid or solid at room temperature and is known for its high thermal stability and low volatility. Its strong acidic nature makes it an effective proton donor, and it is often used as a superacid in various chemical reactions. Pentafluoroethanesulfonic acid is also notable for its hydrophobic characteristics due to the presence of fluorine atoms, which can influence its interactions with other substances. Additionally, it is utilized in the synthesis of ion-exchange membranes and as a catalyst in organic reactions. However, due to its environmental persistence and potential toxicity, handling and disposal require careful consideration in accordance with safety regulations.
Formula:C2HF5O3S
InChI:InChI=1/C2HF5O3S/c3-1(4,5)2(6,7)11(8,9)10/h(H,8,9,10)
SMILES:C(C(F)(F)S(=O)(=O)O)(F)(F)F
Synonyms:- Ethanesulfonic Acid, 1,1,2,2,2-Pentafluoro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
Pentafluoroethane sulfonic acid
CAS:Pentafluoroethane sulfonic acidFormula:C2HF5O3SPurity:97%Color and Shape:LiquidMolecular weight:200.08455Pentafluoroethanesulfonic acid
CAS:Pentafluoroethanesulfonic acid is a fluorinated inorganic acid that is used as a cross-linking agent for polymers. It has an acidic nature due to its protonated form, and can be used to produce silver ion complexes with the addition of silver ions. Pentafluoroethanesulfonic acid also activates radiation and is useful for metal hydroxide synthesis, hydrogen bond formation, cationic polymerization, and chlorine atom substitution reactions. This chemical is stable at room temperature and has low volatility.
Formula:C2HF5O3SPurity:Min. 95%Color and Shape:Clear LiquidMolecular weight:200.09 g/mol



