CAS 37019-18-4: 6-chloro-N-(1-methylpropyl)-1,3,5-triazine-2,4-diamine
Description:6-Chloro-N-(1-methylpropyl)-1,3,5-triazine-2,4-diamine, with the CAS number 37019-18-4, is a chemical compound that belongs to the class of triazines, which are characterized by a six-membered ring containing three nitrogen atoms. This compound features a chloro substituent and a propyl amine group, contributing to its unique reactivity and potential applications. It is typically a solid at room temperature and may exhibit moderate solubility in polar solvents. The presence of the triazine ring suggests potential uses in agricultural chemistry, particularly as a herbicide or in the synthesis of other nitrogen-containing compounds. Its structure allows for various interactions, including hydrogen bonding and electrophilic substitution, which can influence its biological activity and stability. Safety data should be consulted for handling and exposure risks, as with any chemical substance, to ensure proper safety protocols are followed. Overall, this compound's characteristics make it of interest in both industrial and research settings.
Formula:C7H12ClN5
InChI:InChI=1/C7H12ClN5/c1-3-4(2)10-7-12-5(8)11-6(9)13-7/h4H,3H2,1-2H3,(H3,9,10,11,12,13)
- Synonyms:
- 1,3,5-triazine-2,4-diamine, 6-chloro-N~2~-(1-methylpropyl)-
- N-sec-Butyl-6-chlor-1,3,5-triazin-2,4-diamin
- N-sec-Butyl-6-chloro-1,3,5-triazine-2,4-diamine
