CAS 374726-62-2: Mandipropamid
Description:Mandipropamid is a chemical compound classified as a fungicide, primarily used in agriculture to control various fungal diseases in crops. It belongs to the class of compounds known as amides and is characterized by its specific mode of action, which involves inhibiting the growth of fungal pathogens by interfering with their cellular processes. Mandipropamid is particularly effective against downy mildew and other foliar diseases, making it valuable for the protection of a range of crops, including vegetables and ornamental plants. The compound is known for its low toxicity to non-target organisms, including humans and beneficial insects, which enhances its appeal in integrated pest management strategies. Additionally, Mandipropamid exhibits good stability and persistence in the environment, allowing for effective disease control over time. Its application is typically in the form of sprays, and it is often used in combination with other fungicides to enhance efficacy and manage resistance. As with all pesticides, proper handling and adherence to safety guidelines are essential to minimize environmental impact and ensure user safety.
Formula:C23H22ClNO4
InChI:InChI=1S/C23H22ClNO4/c1-4-14-28-20-11-6-17(16-21(20)27-3)12-13-25-23(26)22(29-15-5-2)18-7-9-19(24)10-8-18/h1-2,6-11,16,22H,12-15H2,3H3,(H,25,26)
InChI key:InChIKey=KWLVWJPJKJMCSH-UHFFFAOYSA-N
SMILES:O=C(NCCC1=CC=C(OCC#C)C(OC)=C1)C(OCC#C)C2=CC=C(Cl)C=C2
- Synonyms:
- (±)-Chlorophenyl)-N-[2-[3-methoxy-4-(prop-2-ynyloxy)phenyl]ethyl]-2-(prop-2-ynyloxy)acetamide
- 2-(4-Chlorophenyl)-N-[2-[3-methoxy-4-(prop-2-ynyloxy)phenyl]ethyl]-2-(prop-2-ynyloxy)acetamide
- 2-(4-chlorophenyl)-N-{2-[3-methoxy-4-(prop-2-yn-1-yloxy)phenyl]ethyl}-2-(prop-2-yn-1-yloxy)acetamide
- 4-Chloro-N-[2-[3-methoxy-4-(2-propyn-1-yloxy)phenyl]ethyl]-α-(2-propyn-1-yloxy)benzeneacetamide
- Benzeneacetamide, 4-chloro-N-[2-[3-methoxy-4-(2-propyn-1-yloxy)phenyl]ethyl]-α-(2-propyn-1-yloxy)-
- Benzeneacetamide, 4-chloro-N-[2-[3-methoxy-4-(2-propynyloxy)phenyl]ethyl]-α-(2-propynyloxy)-
- Pergado
- Revus
