CAS 422556-08-9: 3-Pyridinesulfonamide, N-(5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-methoxy-4-(trifluoromethyl)-
Description:3-Pyridinesulfonamide, N-(5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-methoxy-4-(trifluoromethyl)- is a chemical compound characterized by its complex structure, which includes a pyridine ring, a sulfonamide group, and a triazolopyrimidine moiety. This compound features multiple functional groups, including methoxy and trifluoromethyl substituents, which can influence its solubility, reactivity, and biological activity. The presence of the sulfonamide group suggests potential applications in medicinal chemistry, particularly as a pharmacophore in drug development. The trifluoromethyl group is known to enhance lipophilicity and metabolic stability, making such compounds of interest in the design of pharmaceuticals. Additionally, the compound's structural features may contribute to its interactions with biological targets, potentially leading to therapeutic effects. Overall, this compound exemplifies the intricate relationship between molecular structure and biological function, making it a subject of interest in various fields, including medicinal chemistry and drug discovery.
Formula:C14H13F3N6O5S
InChI:InChI=1S/C14H13F3N6O5S/c1-26-8-6-9(27-2)23-13(19-8)20-12(21-23)22-29(24,25)10-7(14(15,16)17)4-5-18-11(10)28-3/h4-6H,1-3H3,(H,21,22)
InChI key:InChIKey=GLBLPMUBLHYFCW-UHFFFAOYSA-N
SMILES:O=S(=O)(NC=1N=C2N=C(OC)C=C(OC)N2N1)C=3C(=NC=CC3C(F)(F)F)OC
- Synonyms:
- 3-Pyridinesulfonamide, N-(5,7-dimethoxy[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-methoxy-4-(trifluoromethyl)-
- 422556-08-9
- De 742
- N-(5,7-Dimethoxy[1,2,4]triazolo[1,5-a]pyrimidin-2-yl)-2-methoxy-4-(trifluoromethyl)-3-pyridinesulfonamide
- Palace
- Pyroxsulam